Difference between revisions of "CPD-10277"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIT CIT] == * smiles: ** C(=O)([O-])CC(C(=O)[O-])(O)CC(=O)[O-] * inchi key: ** InChIKey=KRKNYBC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == * smiles: ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C * inchi key: ** InChIK...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N |
* common name: | * common name: | ||
− | ** | + | ** lotaustralin |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 261.274 |
* Synonym(s): | * Synonym(s): | ||
− | + | ** 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside | |
− | + | ||
− | + | ||
− | ** 2-hydroxy- | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-9674]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13603]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441467 441467] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6542 6542] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles=C( | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08334 C08334] |
− | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB33865 |
− | {{#set: common name= | + | {{#set: smiles=CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N}} |
− | {{#set: common name= | + | {{#set: common name=lotaustralin}} |
− | + | {{#set: molecular weight=261.274 }} | |
− | {{#set: | + | {{#set: common name=2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside}} |
− | {{#set: | + | {{#set: consumed by=RXN-9674}} |
+ | {{#set: produced by=RXN-13603}} |
Revision as of 16:56, 23 May 2018
Contents
Metabolite CPD-10277
- smiles:
- CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C
- inchi key:
- InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N
- common name:
- lotaustralin
- molecular weight:
- 261.274
- Synonym(s):
- 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links