Difference between revisions of "CPD-12218"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-ALKYL-GLYCERONE-3-PHOSPHATE 1-ALKYL-GLYCERONE-3-PHOSPHATE] == * common name: ** a 1-alkyl-gly...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12218 CPD-12218] == * smiles: ** C(CC(O)C1(=CC=CC=C1))([O-])=O * common name: ** 3-hydroxy-...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12218 CPD-12218] == |
| + | * smiles: | ||
| + | ** C(CC(O)C1(=CC=CC=C1))([O-])=O | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-hydroxy-3-phenylpropanoate |
| + | * inchi key: | ||
| + | ** InChIKey=AYOLELPCNDVZKZ-UHFFFAOYSA-M | ||
| + | * molecular weight: | ||
| + | ** 165.168 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-hydroxy-3-phenyl propionic acid |
| − | ** | + | ** 3-hydroxy-3-phenylpropionate |
| − | ** | + | ** beta-hydroxyphenylpropionic acid |
| + | ** 3-hydroxy-3-phenylpropanoic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11270]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11269]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22328018 22328018] |
| − | {{#set: consumed by=RXN- | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.11347248.html 11347248] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63469 63469] | ||
| + | {{#set: smiles=C(CC(O)C1(=CC=CC=C1))([O-])=O}} | ||
| + | {{#set: common name=3-hydroxy-3-phenylpropanoate}} | ||
| + | {{#set: inchi key=InChIKey=AYOLELPCNDVZKZ-UHFFFAOYSA-M}} | ||
| + | {{#set: molecular weight=165.168 }} | ||
| + | {{#set: common name=3-hydroxy-3-phenyl propionic acid|3-hydroxy-3-phenylpropionate|beta-hydroxyphenylpropionic acid|3-hydroxy-3-phenylpropanoic acid}} | ||
| + | {{#set: consumed by=RXN-11270}} | ||
| + | {{#set: produced by=RXN-11269}} | ||
Revision as of 15:57, 23 May 2018
Contents
Metabolite CPD-12218
- smiles:
- C(CC(O)C1(=CC=CC=C1))([O-])=O
- common name:
- 3-hydroxy-3-phenylpropanoate
- inchi key:
- InChIKey=AYOLELPCNDVZKZ-UHFFFAOYSA-M
- molecular weight:
- 165.168
- Synonym(s):
- 3-hydroxy-3-phenyl propionic acid
- 3-hydroxy-3-phenylpropionate
- beta-hydroxyphenylpropionic acid
- 3-hydroxy-3-phenylpropanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC(O)C1(=CC=CC=C1))([O-])=O" cannot be used as a page name in this wiki.
