Difference between revisions of "CHC T00001494001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19220 CPD-19220] == * smiles: ** C(O)C1(O)(CC(=O)C(O)=C(O)C1) * common name: ** (S)-demethy...")
(Created page with "Category:Gene == Gene CHC_T00001494001_1 == * Synonym(s): == Reactions associated == * Reaction: 3.4.13.9-RXN ** Source: orthology-galdieria.sulphuraria == Pathwa...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19220 CPD-19220] ==
+
== Gene CHC_T00001494001_1 ==
* smiles:
+
** C(O)C1(O)(CC(=O)C(O)=C(O)C1)
+
* common name:
+
** (S)-demethyl-4-deoxygadusol
+
* inchi key:
+
** InChIKey=OWHGXOODGNBQRG-ZETCQYMHSA-N
+
* molecular weight:
+
** 174.153   
+
 
* Synonym(s):
 
* Synonym(s):
** (5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17896]]
+
* Reaction: [[3.4.13.9-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-galdieria.sulphuraria]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
* [[RXN-17895]]
+
 
== External links  ==
 
== External links  ==
{{#set: smiles=C(O)C1(O)(CC(=O)C(O)=C(O)C1)}}
+
{{#set: reaction associated=3.4.13.9-RXN}}
{{#set: common name=(S)-demethyl-4-deoxygadusol}}
+
{{#set: inchi key=InChIKey=OWHGXOODGNBQRG-ZETCQYMHSA-N}}
+
{{#set: molecular weight=174.153    }}
+
{{#set: common name=(5S)-2,3,5-trihydroxy-5-(hydroxymethyl)cyclohex-2-en-1-one}}
+
{{#set: consumed by=RXN-17896}}
+
{{#set: consumed or produced by=RXN-17895}}
+

Latest revision as of 17:00, 23 May 2018

Gene CHC_T00001494001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links