Difference between revisions of "CHC T00008943001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8892 CPD-8892] == * smiles: ** CCCCCC=CCC=CC=CC=C[CH]1(O[CH]1CCCC(=O)[O-]) * inchi key: **...") |
(Created page with "Category:Gene == Gene CHC_T00008943001_1 == * Synonym(s): == Reactions associated == * Reaction: RXN-14971 ** Source: orthology-galdieria.sulphuraria ** Source: [...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008943001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN-14971]] |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | == | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
+ | * Reaction: [[RXN-15378]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Reaction: [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-561]] | ||
+ | * [[PWY-4302]] | ||
+ | * [[PWY-3781]] | ||
+ | * [[PWY0-1353]] | ||
+ | * [[PWY-7279]] | ||
+ | * [[P105-PWY]] | ||
+ | * [[PWY-6969]] | ||
+ | * [[PWY-6728]] | ||
+ | * [[PWY0-1329]] | ||
+ | * [[PWY-7254]] | ||
+ | * [[PWY-5690]] | ||
+ | * [[PWY66-398]] | ||
+ | * [[TCA]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-14971|RXN-15378|SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN}} | |
− | + | {{#set: pathway associated=PWY-561|PWY-4302|PWY-3781|PWY0-1353|PWY-7279|P105-PWY|PWY-6969|PWY-6728|PWY0-1329|PWY-7254|PWY-5690|PWY66-398|TCA}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 16:02, 23 May 2018
Gene CHC_T00008943001_1
- Synonym(s):
Reactions associated
- Reaction: RXN-14971
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-15378
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Reaction: SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
Pathways associated
- PWY-561
- PWY-4302
- PWY-3781
- PWY0-1353
- PWY-7279
- P105-PWY
- PWY-6969
- PWY-6728
- PWY0-1329
- PWY-7254
- PWY-5690
- PWY66-398
- TCA