Difference between revisions of "CPD-5662"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00006498001_1 == * Synonym(s): == Reactions associated == * ASPAMINOTRANS-RXN ** pantograph-galdieria.sulphuraria * RXN-10814 *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] == * smiles: ** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-]) * inchi key: ** InChIKey=Z...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] == |
+ | * smiles: | ||
+ | ** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-]) | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M | ||
+ | * common name: | ||
+ | ** 9-mercaptodethiobiotin | ||
+ | * molecular weight: | ||
+ | ** 245.316 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 9-mercaptodesthiobiotin | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-17473]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-17472]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244092 25244092] |
+ | {{#set: smiles=C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])}} | ||
+ | {{#set: inchi key=InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=9-mercaptodethiobiotin}} | ||
+ | {{#set: molecular weight=245.316 }} | ||
+ | {{#set: common name=9-mercaptodesthiobiotin}} | ||
+ | {{#set: consumed by=RXN-17473}} | ||
+ | {{#set: produced by=RXN-17472}} |
Revision as of 16:04, 23 May 2018
Contents
Metabolite CPD-5662
- smiles:
- C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])
- inchi key:
- InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M
- common name:
- 9-mercaptodethiobiotin
- molecular weight:
- 245.316
- Synonym(s):
- 9-mercaptodesthiobiotin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])" cannot be used as a page name in this wiki.