Difference between revisions of "2-Oxo-carboxylates"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] == * smiles: ** CC1(=NC=C(CO)C(C[N+])=C(O)1) * inchi key: ** InChIKe...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Oxo-carboxylates 2-Oxo-carboxylates] == * common name: ** a 2-oxo carboxylate * Synonym(s): *...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Oxo-carboxylates 2-Oxo-carboxylates] ==
−
* smiles:
+
−
** CC1(=NC=C(CO)C(C[N+])=C(O)1)
+
−
* inchi key:
+
−
** InChIKey=NHZMQXZHNVQTQA-UHFFFAOYSA-O
+
 
* common name:
 
* common name:
−
** pyridoxamine
+
** a 2-oxo carboxylate
−
* molecular weight:
+
−
** 169.203   
+
 
* Synonym(s):
 
* Synonym(s):
−
** PM
+
** 2-oxo acid
 +
** an α keto acid
 +
** a keto acid
 +
** a 2-oxo acid
 +
** a 2-ketocarboxylate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[PYRAMKIN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-14046]]
+
* [[D-AMINO-ACID-OXIDASE-RXN]]
 +
* [[S-2-HYDROXY-ACID-OXIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 
== External links  ==
 
== External links  ==
−
* CAS : 85-87-0
+
{{#set: common name=a 2-oxo carboxylate}}
−
* METABOLIGHTS : MTBLC57761
+
{{#set: common name=2-oxo acid|an α keto acid|a keto acid|a 2-oxo acid|a 2-ketocarboxylate}}
−
* PUBCHEM:
+
{{#set: produced by=D-AMINO-ACID-OXIDASE-RXN|S-2-HYDROXY-ACID-OXIDASE-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245492 25245492]
+
{{#set: reversible reaction associated=ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN}}
−
* HMDB : HMDB01431
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00534 C00534]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57761 57761]
+
−
* BIGG : pydam
+
−
{{#set: smiles=CC1(=NC=C(CO)C(C[N+])=C(O)1)}}
+
−
{{#set: inchi key=InChIKey=NHZMQXZHNVQTQA-UHFFFAOYSA-O}}
+
−
{{#set: common name=pyridoxamine}}
+
−
{{#set: molecular weight=169.203    }}
+
−
{{#set: common name=PM}}
+
−
{{#set: consumed by=PYRAMKIN-RXN}}
+
−
{{#set: produced by=RXN-14046}}
+

Revision as of 16:08, 23 May 2018

Metabolite 2-Oxo-carboxylates

  • common name:
    • a 2-oxo carboxylate
  • Synonym(s):
    • 2-oxo acid
    • an α keto acid
    • a keto acid
    • a 2-oxo acid
    • a 2-ketocarboxylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=2-Oxo-carboxylates&oldid=16275"