Difference between revisions of "CPD-2751"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == * smiles: ** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...") |
|||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == |
− | * | + | * smiles: |
− | ** | + | ** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) |
+ | * inchi key: | ||
+ | ** InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 5'-hydroxycotinine |
+ | * molecular weight: | ||
+ | ** 192.217 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** allohydroxycotinine | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN66-163]] | |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | * [ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9815515 9815515] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.7991265.html 7991265] |
− | {{#set: | + | * HMDB : HMDB01427 |
+ | {{#set: smiles=C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))}} | ||
+ | {{#set: inchi key=InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N}} | ||
+ | {{#set: common name=5'-hydroxycotinine}} | ||
+ | {{#set: molecular weight=192.217 }} | ||
+ | {{#set: common name=allohydroxycotinine}} | ||
+ | {{#set: produced by=RXN66-163}} |
Revision as of 17:08, 23 May 2018
Contents
Metabolite CPD-2751
- smiles:
- C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))
- inchi key:
- InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N
- common name:
- 5'-hydroxycotinine
- molecular weight:
- 192.217
- Synonym(s):
- allohydroxycotinine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links