Difference between revisions of "RXN3O-8214"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTIDINE CYTIDINE] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))O * inchi key: ** InC...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-8214 RXN3O-8214] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-8214 RXN3O-8214] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[CO-A]][c] '''+''' 1 [[Myristoyl-ACPs]][c] '''<=>''' 1 [[TETRADECANOYL-COA]][c] '''+''' 1 [[ACP]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 coenzyme A[c] '''+''' 1 a myristoyl-[acp][c] '''<=>''' 1 myristoyl-CoA[c] '''+''' 1 a holo-[acyl-carrier protein][c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[gap-filling]] | ||
| + | ** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
| + | *** Tool: [[meneco]] | ||
| + | **** Comment: [[added for gapfilling]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: ec number=EC-2.3.1}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=gap-filling}} | |
| − | + | {{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}} | |
| − | + | {{#set: reconstruction tool=meneco}} | |
| − | + | {{#set: reconstruction comment=added for gapfilling}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 16:10, 23 May 2018
Contents
Reaction RXN3O-8214
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CO-A[c] + 1 Myristoyl-ACPs[c] <=> 1 TETRADECANOYL-COA[c] + 1 ACP[c]
- With common name(s):
- 1 coenzyme A[c] + 1 a myristoyl-[acp][c] <=> 1 myristoyl-CoA[c] + 1 a holo-[acyl-carrier protein][c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: gap-filling
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
- Tool: meneco
- Comment: added for gapfilling
- Tool: meneco
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
