Difference between revisions of "CPD-14394"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TETRADECANOYL-COA TETRADECANOYL-COA] == * smiles: ** CCCCCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14394 CPD-14394] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14394 CPD-14394] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PLHICYKOPITJJT-QWOXCLFSSA-J |
* common name: | * common name: | ||
− | ** | + | ** (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl-CoA |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1049.959 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** icosatetraenoyl-CoA |
− | ** | + | ** eicosatetraenoyl-CoA |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-16042]] |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581164 71581164] |
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74265 74265] |
− | + | {{#set: smiles=CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=PLHICYKOPITJJT-QWOXCLFSSA-J}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl-CoA}} |
− | {{#set: common name= | + | {{#set: molecular weight=1049.959 }} |
− | {{#set: molecular weight= | + | {{#set: common name=icosatetraenoyl-CoA|eicosatetraenoyl-CoA}} |
− | {{#set: common name= | + | {{#set: consumed by=RXN-16042}} |
− | {{#set: consumed by=RXN- | + | |
− | + |
Revision as of 16:14, 23 May 2018
Contents
Metabolite CPD-14394
- smiles:
- CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=PLHICYKOPITJJT-QWOXCLFSSA-J
- common name:
- (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl-CoA
- molecular weight:
- 1049.959
- Synonym(s):
- icosatetraenoyl-CoA
- eicosatetraenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.