Difference between revisions of "CPD-18"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_NADH TransportSeed_NADH] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_NADH TransportSeed_NADH] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J
 +
* common name:
 +
** linoleoyl-CoA
 +
* molecular weight:
 +
** 1025.937   
 
* Synonym(s):
 
* Synonym(s):
 +
** cis,cis-octadeca-9,12-dienoyl-CoA
 +
** (9Z,12Z)-octadeca-9,12-dienoyl-CoA
 +
** 18:2(n-6)
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[1.14.19.3-RXN]]
** 1.0 [[NADH]][e] '''=>''' 1.0 [[NADH]][c]
+
* [[LINOLEOYL-RXN]]
* With common name(s):
+
== Reaction(s) known to produce the compound ==
** 1.0 NADH[e] '''=>''' 1.0 NADH[c]
+
* [[RXN-16045]]
 
+
* [[RXN-9601]]
== Genes associated with this reaction  ==
+
* [[RXN-9673]]
== Pathways  ==
+
== Reaction(s) of unknown directionality ==
== Reconstruction information  ==
+
* [[manual]]:
+
** [[added to manage seeds from extracellular to cytosol compartment]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: in pathway=}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245440 25245440]
{{#set: reconstruction category=manual}}
+
* CHEBI:
{{#set: reconstruction source=added to manage seeds from extracellular to cytosol compartment}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57383 57383]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C02050 C02050]
 +
* HMDB : HMDB01064
 +
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: inchi key=InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J}}
 +
{{#set: common name=linoleoyl-CoA}}
 +
{{#set: molecular weight=1025.937    }}
 +
{{#set: common name=cis,cis-octadeca-9,12-dienoyl-CoA|(9Z,12Z)-octadeca-9,12-dienoyl-CoA|18:2(n-6)}}
 +
{{#set: consumed by=1.14.19.3-RXN|LINOLEOYL-RXN}}
 +
{{#set: produced by=RXN-16045|RXN-9601|RXN-9673}}

Revision as of 17:15, 23 May 2018

Metabolite CPD-18

  • smiles:
    • CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J
  • common name:
    • linoleoyl-CoA
  • molecular weight:
    • 1025.937
  • Synonym(s):
    • cis,cis-octadeca-9,12-dienoyl-CoA
    • (9Z,12Z)-octadeca-9,12-dienoyl-CoA
    • 18:2(n-6)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.