Difference between revisions of "UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Primary-Alcohols Primary-Alcohols] == * common name: ** a primary alcohol * Synonym(s): ** 1-Al...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE] == * smiles: ** C=C(OC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE] == |
| + | * smiles: | ||
| + | ** C=C(OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3))C(=O)[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=BEGZZYPUNCJHKP-DBYWSUQTSA-K | ||
* common name: | * common name: | ||
| − | ** | + | ** UDP-N-acetyl-α-D-glucosamine-enolpyruvate |
| + | * molecular weight: | ||
| + | ** 674.382 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** 1- | + | ** UDP-N-acetyl-3-O-(1-carboxyvinyl)-α-D-glucosamine |
| + | ** UDP-N-acetyl-α-D-glucosamine-3-O-pyruvate ether | ||
| + | ** UDP-N-acetyl-3-(1-carboxyvinyl)-α-D-glucosamine | ||
| + | ** UDP-GlcNAc-pyruvate enol ether | ||
| + | ** UDP-GlcNAc-enolpyruvate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[UDPNACETYLMURAMATEDEHYDROG-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: common name=1- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244881 25244881] |
| − | {{#set: consumed | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=68483 68483] | ||
| + | * BIGG : uaccg | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04631 C04631] | ||
| + | {{#set: smiles=C=C(OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3))C(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=BEGZZYPUNCJHKP-DBYWSUQTSA-K}} | ||
| + | {{#set: common name=UDP-N-acetyl-α-D-glucosamine-enolpyruvate}} | ||
| + | {{#set: molecular weight=674.382 }} | ||
| + | {{#set: common name=UDP-N-acetyl-3-O-(1-carboxyvinyl)-α-D-glucosamine|UDP-N-acetyl-α-D-glucosamine-3-O-pyruvate ether|UDP-N-acetyl-3-(1-carboxyvinyl)-α-D-glucosamine|UDP-GlcNAc-pyruvate enol ether|UDP-GlcNAc-enolpyruvate}} | ||
| + | {{#set: consumed by=UDPNACETYLMURAMATEDEHYDROG-RXN}} | ||
Revision as of 16:17, 23 May 2018
Contents
Metabolite UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE
- smiles:
- C=C(OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3))C(=O)[O-]
- inchi key:
- InChIKey=BEGZZYPUNCJHKP-DBYWSUQTSA-K
- common name:
- UDP-N-acetyl-α-D-glucosamine-enolpyruvate
- molecular weight:
- 674.382
- Synonym(s):
- UDP-N-acetyl-3-O-(1-carboxyvinyl)-α-D-glucosamine
- UDP-N-acetyl-α-D-glucosamine-3-O-pyruvate ether
- UDP-N-acetyl-3-(1-carboxyvinyl)-α-D-glucosamine
- UDP-GlcNAc-pyruvate enol ether
- UDP-GlcNAc-enolpyruvate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C(OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3))C(=O)[O-" cannot be used as a page name in this wiki.
