|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYOHMETRANS-RXN GLYOHMETRANS-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-PYR OH-PYR] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C(C(=O)C([O-])=O)O |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/2.1.2.1 EC-2.1.2.1] | + | ** InChIKey=HHDDCCUIIUWNGJ-UHFFFAOYSA-M |
| + | * common name: |
| + | ** hydroxypyruvate |
| + | * molecular weight: |
| + | ** 103.054 |
| * Synonym(s): | | * Synonym(s): |
| + | ** β-hydroxypyruvate |
| + | ** OH-pyruvate |
| + | ** OH-pyr |
| + | ** 3-hydroxypyruvate |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN0-300]] |
− | ** 1 [[THF-GLU-N]][c] '''+''' 1 [[SER]][c] '''<=>''' 1 [[METHYLENE-THF-GLU-N]][c] '''+''' 1 [[GLY]][c] '''+''' 1 [[WATER]][c]
| + | * [[GLYCERATE-DEHYDROGENASE-RXN]] |
− | * With common name(s):
| + | == Reaction(s) known to produce the compound == |
− | ** 1 a tetrahydrofolate[c] '''+''' 1 L-serine[c] '''<=>''' 1 a 5,10-methylene-tetrahydrofolate[c] '''+''' 1 glycine[c] '''+''' 1 H2O[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | * [[HYDROXYPYRUVATE-REDUCTASE-RXN]] |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[CHC_T00008323001_1]] | + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00009460001_1]] | + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | == Pathways == | + | |
− | * [[PWY-2161]], folate polyglutamylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2161 PWY-2161]
| + | |
− | ** '''5''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-181]], photorespiration: [http://metacyc.org/META/NEW-IMAGE?object=PWY-181 PWY-181]
| + | |
− | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-3841]], folate transformations II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3841 PWY-3841]
| + | |
− | ** '''7''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[1CMET2-PWY]], N10-formyl-tetrahydrofolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=1CMET2-PWY 1CMET2-PWY]
| + | |
− | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-3661]], glycine betaine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3661 PWY-3661]
| + | |
− | ** '''4''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[GLYSYN-PWY]], glycine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLYSYN-PWY GLYSYN-PWY]
| + | |
− | ** '''1''' reactions found over '''1''' reactions in the full pathway
| + | |
− | * [[PWY-5497]], purine nucleobases degradation II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5497 PWY-5497]
| + | |
− | ** '''7''' reactions found over '''24''' reactions in the full pathway
| + | |
− | * [[PWY-2201]], folate transformations I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2201 PWY-2201]
| + | |
− | ** '''5''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-1622]], formaldehyde assimilation I (serine pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1622 PWY-1622] | + | |
− | ** '''6''' reactions found over '''13''' reactions in the full pathway
| + | |
− | * [[PWY-3661-1]], glycine betaine degradation II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3661-1 PWY-3661-1]
| + | |
− | ** '''1''' reactions found over '''4''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[galdieria.sulphuraria]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 1113-60-6 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15481 15481]
| + | * METABOLIGHTS : MTBLC17180 |
− | * LIGAND-RXN:
| + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00945 R00945]
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4186339 4186339] |
− | * UNIPROT: | + | * HMDB : HMDB01352 |
− | ** [http://www.uniprot.org/uniprot/P35623 P35623] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P34898 P34898] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00168 C00168] |
− | ** [http://www.uniprot.org/uniprot/P34899 P34899]
| + | * CHEMSPIDER: |
− | ** [http://www.uniprot.org/uniprot/P34896 P34896]
| + | ** [http://www.chemspider.com/Chemical-Structure.3397158.html 3397158] |
− | ** [http://www.uniprot.org/uniprot/Q9CHW7 Q9CHW7] | + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P34897 P34897] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17180 17180] |
− | ** [http://www.uniprot.org/uniprot/P0A2E1 P0A2E1] | + | * BIGG : hpyr |
− | ** [http://www.uniprot.org/uniprot/O23254 O23254] | + | {{#set: smiles=C(C(=O)C([O-])=O)O}} |
− | ** [http://www.uniprot.org/uniprot/O53441 O53441] | + | {{#set: inchi key=InChIKey=HHDDCCUIIUWNGJ-UHFFFAOYSA-M}} |
− | ** [http://www.uniprot.org/uniprot/O08370 O08370]
| + | {{#set: common name=hydroxypyruvate}} |
− | ** [http://www.uniprot.org/uniprot/P43844 P43844] | + | {{#set: molecular weight=103.054 }} |
− | ** [http://www.uniprot.org/uniprot/Q58992 Q58992] | + | {{#set: common name=β-hydroxypyruvate|OH-pyruvate|OH-pyr|3-hydroxypyruvate}} |
− | ** [http://www.uniprot.org/uniprot/O66776 O66776]
| + | {{#set: consumed by=RXN0-300|GLYCERATE-DEHYDROGENASE-RXN}} |
− | ** [http://www.uniprot.org/uniprot/Q9XAY7 Q9XAY7]
| + | {{#set: reversible reaction associated=HYDROXYPYRUVATE-REDUCTASE-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P47634 P47634] | + | |
− | ** [http://www.uniprot.org/uniprot/Q9WZH9 Q9WZH9]
| + | |
− | ** [http://www.uniprot.org/uniprot/P56089 P56089]
| + | |
− | ** [http://www.uniprot.org/uniprot/O53615 O53615]
| + | |
− | ** [http://www.uniprot.org/uniprot/O83349 O83349]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZMP7 Q9ZMP7]
| + | |
− | ** [http://www.uniprot.org/uniprot/O51547 O51547]
| + | |
− | ** [http://www.uniprot.org/uniprot/O84439 O84439]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24531 P24531]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39148 P39148]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24060 P24060]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37292 P37292]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34895 P34895]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34894 P34894]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49357 P49357]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49358 P49358]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50433 P50433]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37291 P37291]
| + | |
− | ** [http://www.uniprot.org/uniprot/P78011 P78011]
| + | |
− | ** [http://www.uniprot.org/uniprot/P77962 P77962]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SVM4 Q9SVM4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SUU0 Q9SUU0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SZJ5 Q9SZJ5]
| + | |
− | ** [http://www.uniprot.org/uniprot/O23984 O23984]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A825 P0A825]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07511 P07511]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: ec number=EC-2.1.2.1}} | + | |
− | {{#set: gene associated=CHC_T00008323001_1|CHC_T00009460001_1}} | + | |
− | {{#set: in pathway=PWY-2161|PWY-181|PWY-3841|1CMET2-PWY|PWY-3661|GLYSYN-PWY|PWY-5497|PWY-2201|PWY-1622|PWY-3661-1}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}} | + | |
− | {{#set: reconstruction source=galdieria.sulphuraria}}
| + | |