Difference between revisions of "RXN-9648"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA MALONYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)[O-])COP(=O)(OP(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9648 RXN-9648] == * direction: ** LEFT-TO-RIGHT * common name: ** Beta-ketoacyl synthase * ec n...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA MALONYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9648 RXN-9648] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LTYOQGRJFJAKNA-DVVLENMVSA-I
+
 
* common name:
 
* common name:
−
** malonyl-CoA
+
** Beta-ketoacyl synthase
−
* molecular weight:
+
* ec number:
−
** 848.541   
+
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
 +
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
 +
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
−
** malonyl coenzyme A
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7645]]
+
* With identifiers:
−
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
+
** 1 [[MALONYL-COA]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Butanoyl-ACPs]][c] '''=>''' 1 [[3-oxo-hexanoyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CO-A]][c]
−
* [[RXN1G-445]]
+
* With common name(s):
−
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
+
** 1 malonyl-CoA[c] '''+''' 1 H+[c] '''+''' 1 a butyryl-[acp][c] '''=>''' 1 a 3-oxo-hexanoyl-[acp][c] '''+''' 1 CO2[c] '''+''' 1 coenzyme A[c]
−
* [[RXN-9654]]
+
 
−
* [[RXN1G-368]]
+
== Genes associated with this reaction  ==
−
* [[RXN-13322]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[RXN-9632]]
+
* Gene: [[CHC_T00009465001_1]]
−
* [[RXN-9653]]
+
** Source: [[orthology-ectocarpus_siliculosus]]
−
* [[RXN-9652]]
+
* Gene: [[CHC_T00009465001]]
−
* [[RXN-9651]]
+
** Source: [[annotation-original_genome]]
−
* [[RXN-9650]]
+
*** Assignment: AUTOMATED-NAME-MATCH
−
* [[FATTY-ACYL-COA-SYNTHASE-RXN]]
+
== Pathways  ==
−
* [[RXN-10059]]
+
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
−
* [[RXN-11468]]
+
** '''22''' reactions found over '''31''' reactions in the full pathway
−
* [[RXN-13297]]
+
== Reconstruction information  ==
−
* [[RXN-13295]]
+
* Category: [[orthology]]
−
* [[RXN-16016]]
+
** Source: [[orthology-ectocarpus_siliculosus]]
−
* [[RXN-3142]]
+
*** Tool: [[pantograph]]
−
* [[RXN1G-499]]
+
* Category: [[annotation]]
−
* [[RXN-9648]]
+
** Source: [[annotation-original_genome]]
−
* [[RXN-9728]]
+
*** Tool: [[pathwaytools]]
−
== Reaction(s) known to produce the compound ==
+
−
* [[RXN0-5055]]
+
−
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
+
−
== Reaction(s) of unknown directionality ==
+
−
* [[FATTY-ACID-SYNTHASE-RXN]]
+
−
* [[RXN-7825]]
+
 
== External links  ==
 
== External links  ==
−
* CAS : 524-14-1
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC57384
+
{{#set: common name=Beta-ketoacyl synthase}}
−
* PUBCHEM:
+
{{#set: ec number=EC-2.3.1.86}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266608 45266608]
+
{{#set: ec number=EC-2.3.1.85}}
−
* HMDB : HMDB01175
+
{{#set: ec number=EC-2.3.1.41}}
−
* LIGAND-CPD:
+
{{#set: gene associated=CHC_T00009465001_1|CHC_T00009465001}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00083 C00083]
+
{{#set: in pathway=PWY-5994}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57384 57384]
+
{{#set: reconstruction source=annotation-original_genome|orthology-ectocarpus_siliculosus}}
−
* BIGG : malcoa
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)[O-])COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=LTYOQGRJFJAKNA-DVVLENMVSA-I}}
+
−
{{#set: common name=malonyl-CoA}}
+
−
{{#set: molecular weight=848.541    }}
+
−
{{#set: common name=malonyl coenzyme A}}
+
−
{{#set: consumed by=RXN-7645|NARINGENIN-CHALCONE-SYNTHASE-RXN|RXN1G-445|MALONYL-COA-ACP-TRANSACYL-RXN|RXN-9654|RXN1G-368|RXN-13322|RXN-9632|RXN-9653|RXN-9652|RXN-9651|RXN-9650|FATTY-ACYL-COA-SYNTHASE-RXN|RXN-10059|RXN-11468|RXN-13297|RXN-13295|RXN-16016|RXN-3142|RXN1G-499|RXN-9648|RXN-9728}}
+
−
{{#set: produced by=RXN0-5055|ACETYL-COA-CARBOXYLTRANSFER-RXN}}
+
−
{{#set: consumed or produced by=FATTY-ACID-SYNTHASE-RXN|RXN-7825}}
+

Latest revision as of 16:18, 23 May 2018

Reaction RXN-9648

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
    • 22 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-9648&oldid=16774"