Difference between revisions of "CHC T00003664001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] == * smiles: ** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1) * inchi key: ** InChIKey...")
 
(Created page with "Category:Gene == Gene CHC_T00003664001_1 == * Synonym(s): == Reactions associated == * Reaction: 3.4.24.59-RXN ** Source: orthology-galdieria.sulphuraria ** Sourc...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] ==
+
== Gene CHC_T00003664001_1 ==
* smiles:
+
** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)
+
* inchi key:
+
** InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L
+
* common name:
+
** β-D-fructofuranose 1-phosphate
+
* molecular weight:
+
** 258.121   
+
 
* Synonym(s):
 
* Synonym(s):
** β-D-fructofuranose-1-P
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-8631]]
+
* Reaction: [[3.4.24.59-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-galdieria.sulphuraria]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* CAS : 15978-08-2
+
{{#set: reaction associated=3.4.24.59-RXN}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244216 25244216]
+
* BIGG : f1p
+
{{#set: smiles=C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)}}
+
{{#set: inchi key=InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L}}
+
{{#set: common name=β-D-fructofuranose 1-phosphate}}
+
{{#set: molecular weight=258.121    }}
+
{{#set: common name=β-D-fructofuranose-1-P}}
+
{{#set: consumed by=RXN-8631}}
+

Latest revision as of 16:19, 23 May 2018

Gene CHC_T00003664001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links