Difference between revisions of "CPD-7003"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7913 RXN-7913] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * smiles: ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C *...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7913 RXN-7913] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.7.4.25 EC-2.7.4.25]
+
** InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
−
** [http://enzyme.expasy.org/EC/2.7.4.14 EC-2.7.4.14]
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.7.4.13 EC-2.7.4.13]
+
** tetrahydrogeranylgeranyl diphosphate
 +
* molecular weight:
 +
** 451.456   
 
* Synonym(s):
 
* Synonym(s):
 +
** tetrahydroGGPP
 +
** tetrahydrogeranylgeranyl pyrophosphate
 +
** tetrahydrogeranylgeranyl-PP
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[DCMP]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[DCDP]][c] '''+''' 1 [[ADP]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-7659]]
−
** 1 dCMP[c] '''+''' 1 ATP[c] '''=>''' 1 dCDP[c] '''+''' 1 ADP[c]
+
* [[RXN-7660]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00004355001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
== Pathways  ==
+
−
* [[PWY-7197]], pyrimidine deoxyribonucleotide phosphorylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7197 PWY-7197]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
−
*** [[a.taliana]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25094 25094]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657275 90657275]
−
* LIGAND-RXN:
+
{{#set: smiles=CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R01665 R01665]
+
{{#set: inchi key=InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=tetrahydrogeranylgeranyl diphosphate}}
−
{{#set: ec number=EC-2.7.4.25}}
+
{{#set: molecular weight=451.456    }}
−
{{#set: ec number=EC-2.7.4.14}}
+
{{#set: common name=tetrahydroGGPP|tetrahydrogeranylgeranyl pyrophosphate|tetrahydrogeranylgeranyl-PP}}
−
{{#set: ec number=EC-2.7.4.13}}
+
{{#set: reversible reaction associated=RXN-7659|RXN-7660}}
−
{{#set: gene associated=CHC_T00004355001_1}}
+
−
{{#set: in pathway=PWY-7197}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=galdieria.sulphuraria|a.taliana}}
+

Revision as of 16:21, 23 May 2018

Metabolite CPD-7003

  • smiles:
    • CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
  • inchi key:
    • InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
  • common name:
    • tetrahydrogeranylgeranyl diphosphate
  • molecular weight:
    • 451.456
  • Synonym(s):
    • tetrahydroGGPP
    • tetrahydrogeranylgeranyl pyrophosphate
    • tetrahydrogeranylgeranyl-PP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-7003&oldid=16898"