Difference between revisions of "CPD-13172"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == * smiles: ** CC(C(=O)[O-])C(O)C([O-])=O * inchi key: ** InChIKey=NPYQJIHH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * inchi key: ** InChIKey=WEZ...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M |
* common name: | * common name: | ||
| − | ** | + | ** 6-hydroxy-2-cyclohexen-one-carboxylate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 155.13 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 6-hydroxy-2-cyclohexen-one-carboxylic acid |
| − | + | ** HCC | |
| − | ** | + | |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12252]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940166 52940166] |
| − | + | {{#set: smiles=C(=O)(C1(O)(C=CCCC(=O)1))[O-]}} | |
| − | + | {{#set: inchi key=InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M}} | |
| − | + | {{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylate}} | |
| − | + | {{#set: molecular weight=155.13 }} | |
| − | {{#set: smiles= | + | {{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylic acid|HCC}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: produced by=RXN-12252}} |
| − | {{#set: common name= | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
Revision as of 16:23, 23 May 2018
Contents
Metabolite CPD-13172
- smiles:
- C(=O)(C1(O)(C=CCCC(=O)1))[O-]
- inchi key:
- InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M
- common name:
- 6-hydroxy-2-cyclohexen-one-carboxylate
- molecular weight:
- 155.13
- Synonym(s):
- 6-hydroxy-2-cyclohexen-one-carboxylic acid
- HCC
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)(C1(O)(C=CCCC(=O)1))[O-" cannot be used as a page name in this wiki.
