Difference between revisions of "DGTP"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00002958001_1 == * Synonym(s): == Reactions associated == * PANTOTHENATE-KIN-RXN ** pantograph-galdieria.sulphuraria == Pathways as...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] == |
+ | * smiles: | ||
+ | ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J | ||
+ | * common name: | ||
+ | ** dGTP | ||
+ | * molecular weight: | ||
+ | ** 503.152 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2'-deoxyguanosine-5'-triphosphate | ||
+ | ** deoxy-GTP | ||
+ | ** deoxyguanosine-triphosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-14217]] |
− | + | * [[RXN-14208]] | |
− | == | + | * [[RXN0-385]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[DGDPKIN-RXN]] | |
− | * [[ | + | == Reaction(s) of unknown directionality == |
+ | * [[RXN-14207]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 2564-35-4 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246112 25246112] | ||
+ | * HMDB : HMDB01440 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00286 C00286] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61429 61429] | ||
+ | * BIGG : dgtp | ||
+ | {{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}} | ||
+ | {{#set: inchi key=InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J}} | ||
+ | {{#set: common name=dGTP}} | ||
+ | {{#set: molecular weight=503.152 }} | ||
+ | {{#set: common name=2'-deoxyguanosine-5'-triphosphate|deoxy-GTP|deoxyguanosine-triphosphate}} | ||
+ | {{#set: consumed by=RXN-14217|RXN-14208|RXN0-385}} | ||
+ | {{#set: produced by=DGDPKIN-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-14207}} |
Revision as of 17:24, 23 May 2018
Contents
Metabolite DGTP
- smiles:
- C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
- inchi key:
- InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J
- common name:
- dGTP
- molecular weight:
- 503.152
- Synonym(s):
- 2'-deoxyguanosine-5'-triphosphate
- deoxy-GTP
- deoxyguanosine-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.