Difference between revisions of "SUCC-S-ALD"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L- 2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-] == * common name: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCC-S-ALD SUCC-S-ALD] == * smiles: ** C([CH]=O)CC(=O)[O-] * inchi key: ** InChIKey=UIUJIQZEACW...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCC-S-ALD SUCC-S-ALD] == |
+ | * smiles: | ||
+ | ** C([CH]=O)CC(=O)[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=UIUJIQZEACWQSV-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** succinate semialdehyde |
+ | * molecular weight: | ||
+ | ** 101.082 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** succinyl semialdehyde |
− | ** | + | ** succ-S-ald |
− | ** | + | ** succinic semialdehyde |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-5293]] |
+ | * [[SUCCSEMIALDDEHYDROG-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | * CAS : 692-29-5 | |
− | {{#set: | + | * METABOLIGHTS : MTBLC57706 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543238 9543238] |
+ | * HMDB : HMDB01259 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00232 C00232] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.7822211.html 7822211] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57706 57706] | ||
+ | * BIGG : sucsal | ||
+ | {{#set: smiles=C([CH]=O)CC(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=UIUJIQZEACWQSV-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=succinate semialdehyde}} | ||
+ | {{#set: molecular weight=101.082 }} | ||
+ | {{#set: common name=succinyl semialdehyde|succ-S-ald|succinic semialdehyde}} | ||
+ | {{#set: consumed by=RXN0-5293|SUCCSEMIALDDEHYDROG-RXN}} |
Revision as of 16:24, 23 May 2018
Contents
Metabolite SUCC-S-ALD
- smiles:
- C([CH]=O)CC(=O)[O-]
- inchi key:
- InChIKey=UIUJIQZEACWQSV-UHFFFAOYSA-M
- common name:
- succinate semialdehyde
- molecular weight:
- 101.082
- Synonym(s):
- succinyl semialdehyde
- succ-S-ald
- succinic semialdehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 692-29-5
- METABOLIGHTS : MTBLC57706
- PUBCHEM:
- HMDB : HMDB01259
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : sucsal
"C([CH]=O)CC(=O)[O-" cannot be used as a page name in this wiki.