Difference between revisions of "CPD-12119"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15661 CPD-15661] == * smiles: ** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12119 CPD-12119] == * smiles: ** CC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12119 CPD-12119] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=FNBTZSJWSSLPPL-ALCXCGRTSA-N |
* common name: | * common name: | ||
− | ** | + | ** demethylmenaquinol-10 |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 841.354 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** DMKH2-10 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-9361]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479447 45479447] |
− | {{#set: smiles | + | * CHEBI: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84546 84546] |
− | {{#set: common name= | + | {{#set: smiles=CC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=FNBTZSJWSSLPPL-ALCXCGRTSA-N}} |
− | {{#set: common name= | + | {{#set: common name=demethylmenaquinol-10}} |
− | {{#set: | + | {{#set: molecular weight=841.354 }} |
+ | {{#set: common name=DMKH2-10}} | ||
+ | {{#set: consumed by=RXN-9361}} |
Revision as of 16:26, 23 May 2018
Contents
Metabolite CPD-12119
- smiles:
- CC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C
- inchi key:
- InChIKey=FNBTZSJWSSLPPL-ALCXCGRTSA-N
- common name:
- demethylmenaquinol-10
- molecular weight:
- 841.354
- Synonym(s):
- DMKH2-10
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links