Difference between revisions of "CPD-14378"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NI+2 NI+2] == * smiles: ** [Ni++] * inchi key: ** InChIKey=VEQPNABPJHWNSG-UHFFFAOYSA-N * common...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14378 CPD-14378] == * smiles: ** C([N+])CC[N+]=CCCC[N+] * inchi key: ** InChIKey=YAVLYBVKPX...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14378 CPD-14378] == |
* smiles: | * smiles: | ||
| − | ** [ | + | ** C([N+])CC[N+]=CCCC[N+] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q |
* common name: | * common name: | ||
| − | ** | + | ** dehydrospermidine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 146.255 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13415]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13414]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266746 45266746] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58732 58732] |
| − | * | + | * METABOLIGHTS : MTBLC58732 |
| − | {{#set: smiles=[ | + | {{#set: smiles=C([N+])CC[N+]=CCCC[N+]}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q}} |
| − | {{#set: common name= | + | {{#set: common name=dehydrospermidine}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=146.255 }} |
| − | + | {{#set: consumed by=RXN-13415}} | |
| − | {{#set: consumed by= | + | {{#set: produced by=RXN-13414}} |
| − | {{#set: produced by= | + | |
Revision as of 16:28, 23 May 2018
Contents
Metabolite CPD-14378
- smiles:
- C([N+])CC[N+]=CCCC[N+]
- inchi key:
- InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q
- common name:
- dehydrospermidine
- molecular weight:
- 146.255
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+])CC[N+]=CCCC[N+" cannot be used as a page name in this wiki.
