Difference between revisions of "RXN-11368"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARATE COUMARATE] == * smiles: ** C(=O)([O-])C=CC1(=CC=C(O)C=C1) * inchi key: ** InChIKey=NG...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11368 RXN-11368] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11368 RXN-11368] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.5.1.39 EC-2.5.1.39] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[4- | + | * With identifiers: |
− | + | ** 1 [[4-hydroxybenzoate]][c] '''+''' 1 [[Polyisoprenyl-Diphosphates]][c] '''<=>''' 1 [[4-Hydroxy-3-polyprenylbenzoates]][c] '''+''' 1 [[PPI]][c] | |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 4-hydroxybenzoate[c] '''+''' 1 an isoprenoid diphosphate[c] '''<=>''' 1 a 4-hydroxy-3-polyprenylbenzoate[c] '''+''' 1 diphosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00002263001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05000 R05000] | |
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: ec number=EC-2.5.1.39}} | |
− | * LIGAND- | + | {{#set: gene associated=CHC_T00002263001_1}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=}} |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:28, 23 May 2018
Contents
Reaction RXN-11368
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 4-hydroxybenzoate[c] + 1 Polyisoprenyl-Diphosphates[c] <=> 1 4-Hydroxy-3-polyprenylbenzoates[c] + 1 PPI[c]
- With common name(s):
- 1 4-hydroxybenzoate[c] + 1 an isoprenoid diphosphate[c] <=> 1 a 4-hydroxy-3-polyprenylbenzoate[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00002263001_1
- Source: orthology-galdieria.sulphuraria
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
External links
- LIGAND-RXN: