Difference between revisions of "RXN-15560"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-785 CPD-785] == * smiles: ** C(CC(C=CC(C([O-])=O)=O)C([O-])=O)([O-])=O * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15560 RXN-15560] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15560 RXN-15560] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.2.26 EC-2.3.2.26] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[S-ubiquitinyl-HECT-E3-UCP-L-cysteine]][c] '''+''' 1 [[Protein-L-lysine]][c] '''=>''' 1 [[PROTEIN-N-UBIQUITYL-LYSINE]][c] '''+''' 1 [[HECT-Ubiquitin-carrier-protein-E3-L-cys]][c] '''+''' 1 [[PROTON]][c] |
− | == | + | * With common name(s): |
− | == | + | ** 1 an S-ubiquitinyl-[HECT-type E3 ubiquitin transferase]-L-cysteine[c] '''+''' 1 a [protein]-L-lysine[c] '''=>''' 1 an N6-monoubiquitinyl-[protein]-L-lysine[c] '''+''' 1 a [HECT-type E3 ubiquitin transferase]-L-cysteine[c] '''+''' 1 H+[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00007701001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7511]], protein ubiquitylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7511 PWY-7511] | ||
+ | ** '''9''' reactions found over '''9''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-2.3.2.26}} | |
− | + | {{#set: gene associated=CHC_T00007701001_1}} | |
− | + | {{#set: in pathway=PWY-7511}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:29, 23 May 2018
Contents
Reaction RXN-15560
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 S-ubiquitinyl-HECT-E3-UCP-L-cysteine[c] + 1 Protein-L-lysine[c] => 1 PROTEIN-N-UBIQUITYL-LYSINE[c] + 1 HECT-Ubiquitin-carrier-protein-E3-L-cys[c] + 1 PROTON[c]
- With common name(s):
- 1 an S-ubiquitinyl-[HECT-type E3 ubiquitin transferase]-L-cysteine[c] + 1 a [protein]-L-lysine[c] => 1 an N6-monoubiquitinyl-[protein]-L-lysine[c] + 1 a [HECT-type E3 ubiquitin transferase]-L-cysteine[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00007701001_1
- Source: orthology-galdieria.sulphuraria
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria