Difference between revisions of "RXN66-18"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETOGLUTARATE 2-KETOGLUTARATE] == * smiles: ** C(CC([O-])=O)C(=O)C([O-])=O * inchi key: ** In...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-18 RXN66-18] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-18 RXN66-18] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.170 EC-1.1.1.170] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * | + | ** 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[CPD-8613]][c] '''=>''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-8614]][c] |
− | * [[ | + | * With common name(s): |
− | + | ** 1 NAD(P)+[c] '''+''' 1 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol[c] '''=>''' 1 NAD(P)H[c] '''+''' 1 CO2[c] '''+''' 1 4α-methyl-5α-cholesta-8-en-3-one[c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | + | * Gene: [[CHC_T00003646001_1]] | |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | = | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | + | == Pathways == | |
− | + | * [[PWY66-3]], cholesterol biosynthesis II (via 24,25-dihydrolanosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3] | |
− | + | ** '''15''' reactions found over '''22''' reactions in the full pathway | |
− | + | == Reconstruction information == | |
− | + | * Category: [[orthology]] | |
− | + | ** Source: [[orthology-ectocarpus_siliculosus]] | |
− | * | + | *** Tool: [[pantograph]] |
− | * [ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | + | *** Tool: [[pantograph]] | |
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-1.1.1.170}} | |
− | + | {{#set: gene associated=CHC_T00003646001_1}} | |
− | + | {{#set: in pathway=PWY66-3}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:29, 23 May 2018
Contents
Reaction RXN66-18
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NAD-P-OR-NOP[c] + 1 CPD-8613[c] => 1 NADH-P-OR-NOP[c] + 1 CARBON-DIOXIDE[c] + 1 CPD-8614[c]
- With common name(s):
- 1 NAD(P)+[c] + 1 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol[c] => 1 NAD(P)H[c] + 1 CO2[c] + 1 4α-methyl-5α-cholesta-8-en-3-one[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00003646001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
Pathways
- PWY66-3, cholesterol biosynthesis II (via 24,25-dihydrolanosterol): PWY66-3
- 15 reactions found over 22 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus