Difference between revisions of "CPD0-1905"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11887 RXN-11887] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11887 RXN-11887] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.14.19.20 EC-1.14.19.20]
+
** InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J
 +
* common name:
 +
** 8-oxo-dGTP
 +
* molecular weight:
 +
** 519.151   
 
* Synonym(s):
 
* Synonym(s):
 +
** 8-oxo-7,8-dihydro-2'-dGTP
 +
** 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''=>''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 1 [[CPD-8646]][c] '''+''' 2 [[WATER]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-14205]]
−
** 1 5α-cholesta-7,24-dien-3β-ol[c] '''+''' 2 H+[c] '''+''' 1 oxygen[c] '''+''' 2 a ferrocytochrome b5[c] '''=>''' 2 a ferricytochrome b5[c] '''+''' 1 7-dehydrodesmosterol[c] '''+''' 2 H2O[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00006481001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4]
+
−
** '''15''' reactions found over '''22''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=34004 34004]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237341 44237341]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-1.14.19.20}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77896 77896]
−
{{#set: gene associated=CHC_T00006481001_1}}
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
−
{{#set: in pathway=PWY66-4}}
+
{{#set: inchi key=InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=8-oxo-dGTP}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=519.151    }}
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: common name=8-oxo-7,8-dihydro-2'-dGTP|8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate}}
 +
{{#set: reversible reaction associated=RXN-14205}}

Revision as of 17:29, 23 May 2018

Metabolite CPD0-1905

  • smiles:
    • C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
  • inchi key:
    • InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J
  • common name:
    • 8-oxo-dGTP
  • molecular weight:
    • 519.151
  • Synonym(s):
    • 8-oxo-7,8-dihydro-2'-dGTP
    • 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD0-1905&oldid=17251"