Difference between revisions of "CPD-7066"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-ADIPATE-DEHYDROG-RXN 2-KETO-ADIPATE-DEHYDROG-RXN] == * direction: ** LEFT-TO-RIGHT * Synonym...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == * smiles: ** CC(C(=O)[O-])C(O)C([O-])=O * inchi key: ** InChIKey=NPYQJIHH...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-ADIPATE-DEHYDROG-RXN 2-KETO-ADIPATE-DEHYDROG-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C(=O)[O-])C(O)C([O-])=O
 +
* inchi key:
 +
** InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L
 +
* common name:
 +
** (2R,3S)-3-methylmalate
 +
* molecular weight:
 +
** 146.099   
 
* Synonym(s):
 
* Synonym(s):
 +
** D-erythro-3-methylmalate
 +
** erythro-β-methyl-D-malate
 +
** β-erythro-methylmalate
 +
** β-methyl-D-malate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-7745]]
** 1 [[CO-A]][c] '''+''' 1 [[2K-ADIPATE]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[GLUTARYL-COA]][c] '''+''' 1 [[NADH]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 coenzyme A[c] '''+''' 1 2-oxoadipate[c] '''+''' 1 NAD+[c] '''=>''' 1 CO2[c] '''+''' 1 glutaryl-CoA[c] '''+''' 1 NADH[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00010023001_1]]
+
** [[pantograph]]-[[a.taliana]]
+
* [[CHC_T00008312001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00010287001_1]]
+
** [[pantograph]]-[[a.taliana]]
+
* [[CHC_T00008441001_1]]
+
** [[pantograph]]-[[a.taliana]]
+
== Pathways  ==
+
* [[PWY-5652]], 2-amino-3-carboxymuconate semialdehyde degradation to glutaryl-CoA: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5652 PWY-5652]
+
** '''1''' reactions found over '''5''' reactions in the full pathway
+
* [[PWY66-425]], L-lysine degradation II (L-pipecolate pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-425 PWY66-425]
+
** '''1''' reactions found over '''8''' reactions in the full pathway
+
* [[LYSINE-DEG1-PWY]], L-lysine degradation XI (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=LYSINE-DEG1-PWY LYSINE-DEG1-PWY]
+
** '''1''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
*** [[a.taliana]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* PUBCHEM:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30795 30795]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266666 45266666]
* LIGAND-RXN:
+
* CHEBI:
** [http://www.genome.jp/dbget-bin/www_bget?R01933 R01933]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58511 58511]
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
{{#set: gene associated=CHC_T00010023001_1|CHC_T00008312001_1|CHC_T00010287001_1|CHC_T00008441001_1}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06029 C06029]
{{#set: in pathway=PWY-5652|PWY66-425|LYSINE-DEG1-PWY}}
+
{{#set: smiles=CC(C(=O)[O-])C(O)C([O-])=O}}
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=(2R,3S)-3-methylmalate}}
{{#set: reconstruction source=galdieria.sulphuraria|a.taliana}}
+
{{#set: molecular weight=146.099    }}
 +
{{#set: common name=D-erythro-3-methylmalate|erythro-β-methyl-D-malate|β-erythro-methylmalate|β-methyl-D-malate}}
 +
{{#set: consumed by=RXN-7745}}

Revision as of 17:29, 23 May 2018

Metabolite CPD-7066

  • smiles:
    • CC(C(=O)[O-])C(O)C([O-])=O
  • inchi key:
    • InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L
  • common name:
    • (2R,3S)-3-methylmalate
  • molecular weight:
    • 146.099
  • Synonym(s):
    • D-erythro-3-methylmalate
    • erythro-β-methyl-D-malate
    • β-erythro-methylmalate
    • β-methyl-D-malate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C(=O)[O-])C(O)C([O-])=O" cannot be used as a page name in this wiki.