Difference between revisions of "CHC T00009392001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] == * smiles: ** CC2(=C(SC(C(C)O)=[N+](CC1(...")
 
(Created page with "Category:Gene == Gene CHC_T00009392001_1 == * Synonym(s): == Reactions associated == * Reaction: 2.7.10.1-RXN ** Source: orthology-galdieria.sulphuraria ** Source...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] ==
+
== Gene CHC_T00009392001_1 ==
* smiles:
+
** CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])
+
* inchi key:
+
** InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L
+
* common name:
+
** 2-(α-hydroxyethyl)thiamine diphosphate
+
* molecular weight:
+
** 466.341   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-(α-hydroxyethyl)-TPP
 
** 2-(α-hydroxyethyl)-ThPP
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-12508]]
+
* Reaction: [[2.7.10.1-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-galdieria.sulphuraria]]
* [[RXN-12583]]
+
** Source: [[orthology-ectocarpus_siliculosus]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[2.7.12.1-RXN]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Reaction: [[PROTEIN-KINASE-RXN]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Reaction: [[RXN-14906]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=2.7.10.1-RXN|2.7.12.1-RXN|PROTEIN-KINASE-RXN|RXN-14906}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878487 46878487]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58939 58939]
+
{{#set: smiles=CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])}}
+
{{#set: inchi key=InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L}}
+
{{#set: common name=2-(α-hydroxyethyl)thiamine diphosphate}}
+
{{#set: molecular weight=466.341    }}
+
{{#set: common name=2-(α-hydroxyethyl)-TPP|2-(α-hydroxyethyl)-ThPP}}
+
{{#set: consumed by=RXN-12508}}
+
{{#set: produced by=RXN-12583}}
+

Latest revision as of 16:29, 23 May 2018

Gene CHC_T00009392001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links