Difference between revisions of "FMNH2"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00007932001_1 == * Synonym(s): == Reactions associated == * RXN-12457 ** pantograph-galdieria.sulphuraria == Pathways associated ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMNH2 FMNH2] == * smiles: ** CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMNH2 FMNH2] == |
+ | * smiles: | ||
+ | ** CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=YTNIXZGTHTVJBW-SCRDCRAPSA-L | ||
+ | * common name: | ||
+ | ** FMNH2 | ||
+ | * molecular weight: | ||
+ | ** 456.348 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Reduced FMN | ||
+ | ** reduced flavin mononucleotide | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-9510]] | |
== External links == | == External links == | ||
− | {{#set: reaction associated=RXN- | + | * CAS : 5666-16-0 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229161 44229161] | ||
+ | * HMDB : HMDB01142 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01847 C01847] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57618 57618] | ||
+ | * BIGG : fmnh2 | ||
+ | {{#set: smiles=CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3)))}} | ||
+ | {{#set: inchi key=InChIKey=YTNIXZGTHTVJBW-SCRDCRAPSA-L}} | ||
+ | {{#set: common name=FMNH2}} | ||
+ | {{#set: molecular weight=456.348 }} | ||
+ | {{#set: common name=Reduced FMN|reduced flavin mononucleotide}} | ||
+ | {{#set: reversible reaction associated=RXN-9510}} |
Revision as of 16:30, 23 May 2018
Contents
Metabolite FMNH2
- smiles:
- CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3)))
- inchi key:
- InChIKey=YTNIXZGTHTVJBW-SCRDCRAPSA-L
- common name:
- FMNH2
- molecular weight:
- 456.348
- Synonym(s):
- Reduced FMN
- reduced flavin mononucleotide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3)))" cannot be used as a page name in this wiki.