Difference between revisions of "CPD-356"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7609 RXN-7609] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-356 CPD-356] == * smiles: ** C(O)C1(OC(=O)C(O)C(O)1) * inchi key: ** InChIKey=CUOKHACJLGPRH...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7609 RXN-7609] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-356 CPD-356] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C1(OC(=O)C(O)C(O)1)
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.1.3.5 EC-3.1.3.5]
+
** InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N
 +
* common name:
 +
** D-arabinono-1,4-lactone
 +
* molecular weight:
 +
** 148.115   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[1.1.3.37-RXN]]
−
** 1 [[WATER]][c] '''+''' 1 [[GMP]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[GUANOSINE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 1 GMP[c] '''=>''' 1 phosphate[c] '''+''' 1 guanosine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008300001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
* [[CHC_T00000267001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
== Pathways  ==
+
−
* [[PWY-6608]], guanosine nucleotides degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6608 PWY-6608]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-6607]], guanosine nucleotides degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6607 PWY-6607]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-6606]], guanosine nucleotides degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6606 PWY-6606]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
−
*** [[a.taliana]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27714 27714]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=17723 17723]
−
* LIGAND-RXN:
+
* CHEMSPIDER:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01227 R01227]
+
** [http://www.chemspider.com/Chemical-Structure.16751.html 16751]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-3.1.3.5}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16292 16292]
−
{{#set: gene associated=CHC_T00008300001_1|CHC_T00000267001_1}}
+
* LIGAND-CPD:
−
{{#set: in pathway=PWY-6608|PWY-6607|PWY-6606}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00652 C00652]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=C(O)C1(OC(=O)C(O)C(O)1)}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N}}
−
{{#set: reconstruction source=galdieria.sulphuraria|a.taliana}}
+
{{#set: common name=D-arabinono-1,4-lactone}}
 +
{{#set: molecular weight=148.115    }}
 +
{{#set: consumed by=1.1.3.37-RXN}}

Revision as of 16:30, 23 May 2018

Metabolite CPD-356

  • smiles:
    • C(O)C1(OC(=O)C(O)C(O)1)
  • inchi key:
    • InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N
  • common name:
    • D-arabinono-1,4-lactone
  • molecular weight:
    • 148.115
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-356&oldid=17308"