Difference between revisions of "TransportSeed CARBON-DIOXIDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] == * smiles: ** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_CARBON-DIOXIDE TransportSeed_CARBON-DIOXIDE] == * direction: ** LEFT-TO-RIGHT * Synon...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_CARBON-DIOXIDE TransportSeed_CARBON-DIOXIDE] ==
* smiles:
+
* direction:
** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J
+
* common name:
+
** (7Z)-tetradecenoyl-CoA
+
* molecular weight:
+
** 971.845   
+
 
* Synonym(s):
 
* Synonym(s):
** 14:1-Δ7-CoA
 
** cis-7-tetradecenoyl-CoA
 
** 14:1(n-7)-CoA
 
** (7Z)-tetradec-7-enoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17792]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[CARBON-DIOXIDE]][e] '''=>''' 1.0 [[CARBON-DIOXIDE]][c]
* [[RXN-17791]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1.0 CO2[e] '''=>''' 1.0 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-import_from_medium]]
 +
*** Comment: [[added to manage seeds from extracellular to cytosol compartment]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J}}
+
{{#set: in pathway=}}
{{#set: common name=(7Z)-tetradecenoyl-CoA}}
+
{{#set: reconstruction category=manual}}
{{#set: molecular weight=971.845    }}
+
{{#set: reconstruction source=manual-import_from_medium}}
{{#set: common name=14:1-Δ7-CoA|cis-7-tetradecenoyl-CoA|14:1(n-7)-CoA|(7Z)-tetradec-7-enoyl-CoA}}
+
{{#set: reconstruction comment=added to manage seeds from extracellular to cytosol compartment}}
{{#set: consumed by=RXN-17792}}
+
{{#set: produced by=RXN-17791}}
+

Latest revision as of 16:31, 23 May 2018

Reaction TransportSeed_CARBON-DIOXIDE

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

Reconstruction information

External links