Difference between revisions of "DEHYDROQUINATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9787 RXN-9787] == * direction: ** REVERSIBLE * common name: ** cysteine:[ThiI sulfur-carrier pr...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEHYDROQUINATE DEHYDROQUINATE] == * smiles: ** C1(C(O)C(O)C(=O)CC(O)(C([O-])=O)1) * inchi key:...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9787 RXN-9787] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEHYDROQUINATE DEHYDROQUINATE] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** C1(C(O)C(O)C(=O)CC(O)(C([O-])=O)1)
 +
* inchi key:
 +
** InChIKey=WVMWZWGZRAXUBK-SYTVJDICSA-M
 
* common name:
 
* common name:
** cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase
+
** 3-dehydroquinate
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/2.8.1.7 EC-2.8.1.7]
+
** 189.144   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-dehydroquinic acid
 +
** 5-dehydroquinic acid
 +
** 5-dehydroquinate
 +
** 5-de-H-quinate
 +
** rel-(1R,3R,4S)-1,3,4-trihydroxy-5-oxocyclohexanecarboxylate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[CYS]][c] '''+''' 1 [[Sulfur-Carrier-Proteins-ThiI]][c] '''<=>''' 1 [[L-ALPHA-ALANINE]][c] '''+''' 1 [[Sulfurylated-ThiI]][c]
+
* [[RXN-7967]]
* With common name(s):
+
* [[3-DEHYDROQUINATE-SYNTHASE-RXN]]
** 1 L-cysteine[c] '''+''' 1 a ThiI sulfur-carrier protein[c] '''<=>''' 1 L-alanine[c] '''+''' 1 an S-sulfanyl-[ThiI sulfur-carrier protein][c]
+
== Reaction(s) of unknown directionality ==
 
+
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00000657001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00008053001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00009510001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=REVERSIBLE}}
+
* CAS : 10534-44-8
{{#set: common name=cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase}}
+
* PUBCHEM:
{{#set: ec number=EC-2.8.1.7}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460271 5460271]
{{#set: gene associated=CHC_T00000657001_1|CHC_T00008053001_1|CHC_T00009510001_1}}
+
* HMDB : HMDB12710
{{#set: in pathway=}}
+
* LIGAND-CPD:
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00944 C00944]
{{#set: reconstruction tool=pantograph}}
+
* CHEMSPIDER:
{{#set: reconstruction source=galdieria.sulphuraria}}
+
** [http://www.chemspider.com/Chemical-Structure.4573866.html 4573866]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32364 32364]
 +
* BIGG : 3dhq
 +
{{#set: smiles=C1(C(O)C(O)C(=O)CC(O)(C([O-])=O)1)}}
 +
{{#set: inchi key=InChIKey=WVMWZWGZRAXUBK-SYTVJDICSA-M}}
 +
{{#set: common name=3-dehydroquinate}}
 +
{{#set: molecular weight=189.144    }}
 +
{{#set: common name=3-dehydroquinic acid|5-dehydroquinic acid|5-dehydroquinate|5-de-H-quinate|rel-(1R,3R,4S)-1,3,4-trihydroxy-5-oxocyclohexanecarboxylate}}
 +
{{#set: produced by=RXN-7967|3-DEHYDROQUINATE-SYNTHASE-RXN}}
 +
{{#set: reversible reaction associated=3-DEHYDROQUINATE-DEHYDRATASE-RXN}}

Revision as of 16:32, 23 May 2018

Metabolite DEHYDROQUINATE

  • smiles:
    • C1(C(O)C(O)C(=O)CC(O)(C([O-])=O)1)
  • inchi key:
    • InChIKey=WVMWZWGZRAXUBK-SYTVJDICSA-M
  • common name:
    • 3-dehydroquinate
  • molecular weight:
    • 189.144
  • Synonym(s):
    • 3-dehydroquinic acid
    • 5-dehydroquinic acid
    • 5-dehydroquinate
    • 5-de-H-quinate
    • rel-(1R,3R,4S)-1,3,4-trihydroxy-5-oxocyclohexanecarboxylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C(O)C(O)C(=O)CC(O)(C([O-])=O)1)" cannot be used as a page name in this wiki.