Difference between revisions of "3-UREIDO-ISOBUTYRATE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00003402001_1 == * Synonym(s): == Reactions associated == * DXS-RXN ** pantograph-a.taliana == Pathways associated == * NONMEVIPP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-UREIDO-ISOBUTYRATE 3-UREIDO-ISOBUTYRATE] == * smiles: ** CC(CNC(N)=O)C(=O)[O-] * inchi key: *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-UREIDO-ISOBUTYRATE 3-UREIDO-ISOBUTYRATE] == |
| + | * smiles: | ||
| + | ** CC(CNC(N)=O)C(=O)[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=PHENTZNALBMCQD-GSVOUGTGSA-M | ||
| + | * common name: | ||
| + | ** (R)-3-ureido-isobutanoate | ||
| + | * molecular weight: | ||
| + | ** 145.138 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** N-carbamyl-β-aminoisobutyric acid | ||
| + | ** N-carbamyl-β-aminoisobutyrate | ||
| + | ** (R)-3-ureido-isobutyrate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-11210]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820371 91820371] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.19988990.html 19988990] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74414 74414] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05100 C05100] | ||
| + | * HMDB : HMDB02031 | ||
| + | {{#set: smiles=CC(CNC(N)=O)C(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=PHENTZNALBMCQD-GSVOUGTGSA-M}} | ||
| + | {{#set: common name=(R)-3-ureido-isobutanoate}} | ||
| + | {{#set: molecular weight=145.138 }} | ||
| + | {{#set: common name=N-carbamyl-β-aminoisobutyric acid|N-carbamyl-β-aminoisobutyrate|(R)-3-ureido-isobutyrate}} | ||
| + | {{#set: consumed by=RXN-11210}} | ||
Revision as of 16:33, 23 May 2018
Contents
Metabolite 3-UREIDO-ISOBUTYRATE
- smiles:
- CC(CNC(N)=O)C(=O)[O-]
- inchi key:
- InChIKey=PHENTZNALBMCQD-GSVOUGTGSA-M
- common name:
- (R)-3-ureido-isobutanoate
- molecular weight:
- 145.138
- Synonym(s):
- N-carbamyl-β-aminoisobutyric acid
- N-carbamyl-β-aminoisobutyrate
- (R)-3-ureido-isobutyrate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CNC(N)=O)C(=O)[O-" cannot be used as a page name in this wiki.
