Difference between revisions of "CPD-14673"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-L-alanine N-terminal-L-alanine] == * common name: ** an N-terminal L-alanyl-[protein...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14673 CPD-14673] == * smiles: ** C(#N)CCC1(C=CC=CC=1) * inchi key: ** InChIKey=ACRWYXSKEHUQ...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14673 CPD-14673] == |
| + | * smiles: | ||
| + | ** C(#N)CCC1(C=CC=CC=1) | ||
| + | * inchi key: | ||
| + | ** InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-phenylpropionitrile |
| + | * molecular weight: | ||
| + | ** 131.177 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** benzenepropanenitrile |
| + | ** 2-phenylethyl cyanide | ||
| + | ** 3-phenylpropanonitril | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-18229]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12581 12581] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.12061.html 12061] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85426 85426] | ||
| + | * HMDB : HMDB34236 | ||
| + | {{#set: smiles=C(#N)CCC1(C=CC=CC=1)}} | ||
| + | {{#set: inchi key=InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=3-phenylpropionitrile}} | ||
| + | {{#set: molecular weight=131.177 }} | ||
| + | {{#set: common name=benzenepropanenitrile|2-phenylethyl cyanide|3-phenylpropanonitril}} | ||
| + | {{#set: consumed by=RXN-18229}} | ||
Revision as of 17:33, 23 May 2018
Contents
Metabolite CPD-14673
- smiles:
- C(#N)CCC1(C=CC=CC=1)
- inchi key:
- InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N
- common name:
- 3-phenylpropionitrile
- molecular weight:
- 131.177
- Synonym(s):
- benzenepropanenitrile
- 2-phenylethyl cyanide
- 3-phenylpropanonitril
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
