Difference between revisions of "RXN-11468"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11468 RXN-11468] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11468 RXN-11468] ==
* smiles:
+
* direction:
** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J
+
** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1]
* common name:
+
** (7Z)-hexadecenoyl-CoA
+
* molecular weight:
+
** 999.899   
+
 
* Synonym(s):
 
* Synonym(s):
** cis-hexadec-7-enoyl-CoA
 
** (7Z)-hexadec-7-enoyl-CoA
 
** 16:1 cis-7
 
** 16:1(n-9)
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17779]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 3 [[PROTON]][c] '''+''' 1 [[CPD-12449]][c] '''+''' 3 [[MALONYL-COA]][c] '''=>''' 4 [[CO-A]][c] '''+''' 3 [[CARBON-DIOXIDE]][c] '''+''' 1 [[PHLORETIN]][c]
* [[RXN-17778]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 3 H+[c] '''+''' 1 4-dihydrocoumaroyl-CoA[c] '''+''' 3 malonyl-CoA[c] '''=>''' 4 coenzyme A[c] '''+''' 3 CO2[c] '''+''' 1 phloretin[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009104001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-6515]], phloridzin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6515 PWY-6515]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J}}
+
{{#set: ec number=EC-2.3.1}}
{{#set: common name=(7Z)-hexadecenoyl-CoA}}
+
{{#set: gene associated=CHC_T00009104001_1}}
{{#set: molecular weight=999.899    }}
+
{{#set: in pathway=PWY-6515}}
{{#set: common name=cis-hexadec-7-enoyl-CoA|(7Z)-hexadec-7-enoyl-CoA|16:1 cis-7|16:1(n-9)}}
+
{{#set: reconstruction category=orthology}}
{{#set: consumed by=RXN-17779}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
{{#set: produced by=RXN-17778}}
+
{{#set: reconstruction tool=pantograph}}

Latest revision as of 16:36, 23 May 2018

Reaction RXN-11468

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6515, phloridzin biosynthesis: PWY-6515
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links