Difference between revisions of "RXN-14371"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHE PHE] == * smiles: ** C([O-])(=O)C([N+])CC1(C=CC=CC=1) * inchi key: ** InChIKey=COLNVLDHVKWL...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14371 RXN-14371] == * direction: ** LEFT-TO-RIGHT * common name: ** 1,4-alpha-Glucan branching...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14371 RXN-14371] == |
| − | + | * direction: | |
| − | + | ** LEFT-TO-RIGHT | |
| − | * | + | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** 1,4-alpha-Glucan branching enzyme |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.4.1.18 EC-2.4.1.18] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | * [[ | + | ** n [[1-4-alpha-D-Glucan]][c] '''=>''' n [[WATER]][c] '''+''' 1 [[Alpha-6-alpha-14-glucans]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** n a 1,4-α-D-glucan[c] '''=>''' n H2O[c] '''+''' 1 a (1,6)-α-D-glucosyl-(1,4)-α-glucan[c] |
| − | == | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| + | * Gene: [[CHC_T00008662001_1]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | * Gene: [[CHC_T00008662001]] | ||
| + | ** Source: [[annotation-original_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | * [[PWY-622]], starch biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-622 PWY-622] | ||
| + | ** '''8''' reactions found over '''10''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-original_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=1,4-alpha-Glucan branching enzyme}} | |
| − | + | {{#set: ec number=EC-2.4.1.18}} | |
| − | + | {{#set: gene associated=CHC_T00008662001_1|CHC_T00008662001}} | |
| − | + | {{#set: in pathway=PWY-622}} | |
| − | + | {{#set: reconstruction category=orthology|annotation}} | |
| − | + | {{#set: reconstruction source=annotation-original_genome|orthology-galdieria.sulphuraria}} | |
| − | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:37, 23 May 2018
Contents
Reaction RXN-14371
- direction:
- LEFT-TO-RIGHT
- common name:
- 1,4-alpha-Glucan branching enzyme
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- n 1-4-alpha-D-Glucan[c] => n WATER[c] + 1 Alpha-6-alpha-14-glucans[c]
- With common name(s):
- n a 1,4-α-D-glucan[c] => n H2O[c] + 1 a (1,6)-α-D-glucosyl-(1,4)-α-glucan[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00008662001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00008662001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome
