Difference between revisions of "RXN-16401"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] == * smiles: ** CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16401 RXN-16401] == * direction: ** LEFT-TO-RIGHT * common name: ** long-chain-fatty-acid-CoA l...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16401 RXN-16401] ==
* smiles:
+
* direction:
** CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J
+
 
* common name:
 
* common name:
** 3-oxo-(7Z)-hexadecenoyl-CoA
+
** long-chain-fatty-acid-CoA ligase
* molecular weight:
+
* ec number:
** 1013.883   
+
** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-16:1-Δ7-CoA
 
** 3-oxo-7-cis-hexadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17782]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-17640]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[CPD-17641]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c]
* [[RXN-17781]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 18-hydroxystearate[c] '''+''' 1 coenzyme A[c] '''+''' 1 ATP[c] '''=>''' 1 18-hydroxystearoyl-CoA[c] '''+''' 1 diphosphate[c] '''+''' 1 AMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008811001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00008160001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00009428001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00009428001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00008500001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00008811001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6733]], sporopollenin precursors biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6733 PWY-6733]
 +
** '''5''' reactions found over '''18''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J}}
+
{{#set: common name=long-chain-fatty-acid-CoA ligase}}
{{#set: common name=3-oxo-(7Z)-hexadecenoyl-CoA}}
+
{{#set: ec number=EC-6.2.1.3}}
{{#set: molecular weight=1013.883    }}
+
{{#set: gene associated=CHC_T00008811001_1|CHC_T00008160001_1|CHC_T00009428001_1|CHC_T00009428001|CHC_T00008500001_1|CHC_T00008811001}}
{{#set: common name=3-oxo-16:1-Δ7-CoA|3-oxo-7-cis-hexadecenoyl-CoA}}
+
{{#set: in pathway=PWY-6733}}
{{#set: consumed by=RXN-17782}}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: produced by=RXN-17781}}
+
{{#set: reconstruction source=annotation-original_genome|orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 17:39, 23 May 2018

Reaction RXN-16401

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • long-chain-fatty-acid-CoA ligase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 18-hydroxystearate[c] + 1 coenzyme A[c] + 1 ATP[c] => 1 18-hydroxystearoyl-CoA[c] + 1 diphosphate[c] + 1 AMP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6733, sporopollenin precursors biosynthesis: PWY-6733
    • 5 reactions found over 18 reactions in the full pathway

Reconstruction information

External links