Difference between revisions of "RXN-11832"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANTHRANILATE ANTHRANILATE] == * smiles: ** C(C1(C(=CC=CC=1)N))(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11832 RXN-11832] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11832 RXN-11832] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/2.7.4.14 EC-2.7.4.14] | |
− | * | + | ** [http://enzyme.expasy.org/EC/2.7.4.25 EC-2.7.4.25] |
− | ** | + | |
− | + | ||
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[CMP]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[CDP]][c] '''+''' 1 [[ADP]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 CMP[c] '''+''' 1 ATP[c] '''=>''' 1 CDP[c] '''+''' 1 ADP[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00004355001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7205]], CMP phosphorylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7205 PWY-7205] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11600 11600] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00512 R00512] |
− | + | * UNIPROT: | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/O59845 O59845] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/Q29561 Q29561] |
− | * | + | ** [http://www.uniprot.org/uniprot/P43892 P43892] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q58071 Q58071] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9CEY1 Q9CEY1] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P57064 P57064] |
− | * | + | ** [http://www.uniprot.org/uniprot/P0A6I0 P0A6I0] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P47572 P47572] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: ec number=EC-2.7.4.14}} |
− | {{#set: | + | {{#set: ec number=EC-2.7.4.25}} |
− | {{#set: | + | {{#set: gene associated=CHC_T00004355001_1}} |
− | {{#set: | + | {{#set: in pathway=PWY-7205}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
+ | {{#set: reconstruction source=orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Revision as of 16:39, 23 May 2018
Contents
Reaction RXN-11832
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 CMP[c] + 1 ATP[c] => 1 CDP[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00004355001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-arabidopsis_thaliana
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-arabidopsis_thaliana
External links