Difference between revisions of "RXN66-163"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTOTHENATE PANTOTHENATE] == * smiles: ** CC(C)(CO)C(O)C(=O)NCCC(=O)[O-] * inchi key: ** InChI...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-163 RXN66-163] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTOTHENATE PANTOTHENATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-163 RXN66-163] ==
−
* smiles:
+
* direction:
−
** CC(C)(CO)C(O)C(=O)NCCC(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=GHOKWGTUZJEAQD-ZETCQYMHSA-M
+
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
−
* common name:
+
−
** (R)-pantothenate
+
−
* molecular weight:
+
−
** 218.229   
+
 
* Synonym(s):
 
* Synonym(s):
−
** vitamin B5
 
−
** (R)-pantothenic acid
 
−
** D-pantothenic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[PANTOTHENATE-KIN-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[CPD-2742]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[CPD-2751]][c] '''+''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c]
−
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 cotinine[c] '''+''' 1 oxygen[c] '''=>''' 1 H2O[c] '''+''' 1 5'-hydroxycotinine[c] '''+''' 1 an oxidized [NADPH-hemoprotein reductase][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008799001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00009144001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00008302001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY66-221]], nicotine degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-221 PWY66-221]
 +
** '''3''' reactions found over '''18''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 79-83-4
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* Wikipedia : Vitamin_B5
+
{{#set: ec number=EC-1.14.14.1}}
−
* PUBCHEM:
+
{{#set: gene associated=CHC_T00008799001_1|CHC_T00009144001_1|CHC_T00008302001_1}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167945 167945]
+
{{#set: in pathway=PWY66-221}}
−
* HMDB : HMDB00210
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00864 C00864]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.146912.html 146912]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29032 29032]
+
−
* BIGG : pnto__R
+
−
{{#set: smiles=CC(C)(CO)C(O)C(=O)NCCC(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=GHOKWGTUZJEAQD-ZETCQYMHSA-M}}
+
−
{{#set: common name=(R)-pantothenate}}
+
−
{{#set: molecular weight=218.229    }}
+
−
{{#set: common name=vitamin B5|(R)-pantothenic acid|D-pantothenic acid}}
+
−
{{#set: consumed by=PANTOTHENATE-KIN-RXN}}
+
−
{{#set: produced by=PANTOATE-BETA-ALANINE-LIG-RXN}}
+

Latest revision as of 16:40, 23 May 2018

Reaction RXN66-163

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-221, nicotine degradation V: PWY66-221
    • 3 reactions found over 18 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN66-163&oldid=17812"