Difference between revisions of "CHC T00001932001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-725 CPD-725] == * smiles: ** CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=UYQ...") |
(Created page with "Category:Gene == Gene CHC_T00001932001_1 == * Synonym(s): == Reactions associated == * Reaction: GTP-CYCLOHYDRO-I-RXN ** Source: orthology-galdieria.sulphuraria *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00001932001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[GTP-CYCLOHYDRO-I-RXN]] | |
− | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | == | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
+ | == Pathways associated == | ||
+ | * [[PWY-5663]] | ||
+ | * [[PWY-6147]] | ||
+ | * [[PWY0-1433]] | ||
+ | * [[PWY-7442]] | ||
+ | * [[PWY-5664]] | ||
+ | * [[PWY-6703]] | ||
+ | * [[PWY-6983]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=GTP-CYCLOHYDRO-I-RXN}} | |
− | + | {{#set: pathway associated=PWY-5663|PWY-6147|PWY0-1433|PWY-7442|PWY-5664|PWY-6703|PWY-6983}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 16:42, 23 May 2018
Gene CHC_T00001932001_1
- Synonym(s):
Reactions associated
- Reaction: GTP-CYCLOHYDRO-I-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus