Difference between revisions of "CPD-9646"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3-OXOACYL-ACP-REDUCT-RXN 3-OXOACYL-ACP-REDUCT-RXN] == * direction: ** LEFT-TO-RIGHT * common name:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9646 CPD-9646] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9646 CPD-9646] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])[O-])C)C)C |
+ | * inchi key: | ||
+ | ** InChIKey=UFPHFKCTOZIAFY-NTDVEAECSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** di-trans,octa-cis-undecaprenyl phosphate |
− | + | * molecular weight: | |
− | * | + | ** 845.279 |
− | + | ||
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** ditrans,polycis-undecaprenyl phosphate | ||
+ | ** ditrans,octacis-undecaprenyl phosphate | ||
+ | ** C55-P | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-11347]] | |
− | + | * [[PHOSNACMURPENTATRANS-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[UNDECAPRENYL-DIPHOSPHATASE-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-8975]] | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * LIGAND-CPD: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C17556 C17556] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60392 60392] |
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245635 25245635] | |
− | * | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])[O-])C)C)C}} |
− | ** [http:// | + | {{#set: inchi key=InChIKey=UFPHFKCTOZIAFY-NTDVEAECSA-L}} |
− | + | {{#set: common name=di-trans,octa-cis-undecaprenyl phosphate}} | |
− | + | {{#set: molecular weight=845.279 }} | |
− | + | {{#set: common name=ditrans,polycis-undecaprenyl phosphate|ditrans,octacis-undecaprenyl phosphate|C55-P}} | |
− | + | {{#set: consumed by=RXN-11347|PHOSNACMURPENTATRANS-RXN}} | |
− | + | {{#set: produced by=UNDECAPRENYL-DIPHOSPHATASE-RXN}} | |
− | + | {{#set: reversible reaction associated=RXN-8975}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 16:42, 23 May 2018
Contents
Metabolite CPD-9646
- smiles:
- CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])[O-])C)C)C
- inchi key:
- InChIKey=UFPHFKCTOZIAFY-NTDVEAECSA-L
- common name:
- di-trans,octa-cis-undecaprenyl phosphate
- molecular weight:
- 845.279
- Synonym(s):
- ditrans,polycis-undecaprenyl phosphate
- ditrans,octacis-undecaprenyl phosphate
- C55-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])[O-])C)C)C" cannot be used as a page name in this wiki.