Difference between revisions of "3-HEXAPRENYL-4-HYDROXYBENZOATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15616 CPD-15616] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=BJHIKXHVC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXYBENZOATE 3-HEXAPRENYL-4-HYDROXYBENZOATE] == * smiles: ** CC(C)=CCCC(=CCCC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXYBENZOATE 3-HEXAPRENYL-4-HYDROXYBENZOATE] == |
* smiles: | * smiles: | ||
| − | ** C(O)C(=O) | + | ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=LKMQQQABIGIHGL-LAAQXVIISA-M |
* common name: | * common name: | ||
| − | ** | + | ** 3-hexaprenyl-4-hydroxybenzoate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 545.824 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9003]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740358 54740358] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84492 84492] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles=C(O)C(=O) | + | ** [http://www.genome.jp/dbget-bin/www_bget?C13425 C13425] |
| − | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB06816 |
| − | {{#set: common name= | + | {{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=LKMQQQABIGIHGL-LAAQXVIISA-M}} |
| − | {{#set: | + | {{#set: common name=3-hexaprenyl-4-hydroxybenzoate}} |
| + | {{#set: molecular weight=545.824 }} | ||
| + | {{#set: produced by=RXN-9003}} | ||
Revision as of 17:43, 23 May 2018
Contents
Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE
- smiles:
- CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C
- inchi key:
- InChIKey=LKMQQQABIGIHGL-LAAQXVIISA-M
- common name:
- 3-hexaprenyl-4-hydroxybenzoate
- molecular weight:
- 545.824
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C" cannot be used as a page name in this wiki.
