Difference between revisions of "CPD-12120"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6081 RXN-6081] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12120 CPD-12120] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12120 CPD-12120] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C |
+ | * inchi key: | ||
+ | ** InChIKey=WVRZWRAIHITKPI-SOKMHQJSSA-N | ||
+ | * common name: | ||
+ | ** demethylmenaquinol-11 | ||
+ | * molecular weight: | ||
+ | ** 909.472 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** DMKH2-11 | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-9362]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479212 45479212] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84548 84548] |
− | {{#set: | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C}} |
+ | {{#set: inchi key=InChIKey=WVRZWRAIHITKPI-SOKMHQJSSA-N}} | ||
+ | {{#set: common name=demethylmenaquinol-11}} | ||
+ | {{#set: molecular weight=909.472 }} | ||
+ | {{#set: common name=DMKH2-11}} | ||
+ | {{#set: consumed by=RXN-9362}} |
Revision as of 17:43, 23 May 2018
Contents
Metabolite CPD-12120
- smiles:
- CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C
- inchi key:
- InChIKey=WVRZWRAIHITKPI-SOKMHQJSSA-N
- common name:
- demethylmenaquinol-11
- molecular weight:
- 909.472
- Synonym(s):
- DMKH2-11
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links