Difference between revisions of "CHC T00007788001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]...")
 
(Created page with "Category:Gene == Gene CHC_T00007788001_1 == * Synonym(s): == Reactions associated == * Reaction: ATPASE-RXN ** Source: orthology-ectocarpus_siliculosus ** Source:...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] ==
+
== Gene CHC_T00007788001_1 ==
* smiles:
+
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N
+
* common name:
+
** poriferst-7-enol
+
* molecular weight:
+
** 414.713   
+
 
* Synonym(s):
 
* Synonym(s):
** 22-dihydrochondrillasterol
 
** 24β-ethylcholest-7-en-3β-ol
 
** chondrillast-7-enol
 
** dihydrochondrillasterol
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-13892]]
+
* Reaction: [[ATPASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-ectocarpus_siliculosus]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Reaction: [[ATPSYN-RXN]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways associated ==
 +
* [[PWY-7219]]
 
== External links  ==
 
== External links  ==
* CAS : 18525-35-4
+
{{#set: reaction associated=ATPASE-RXN|ATPSYN-RXN}}
* PUBCHEM:
+
{{#set: pathway associated=PWY-7219}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283639 5283639]
+
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N}}
+
{{#set: common name=poriferst-7-enol}}
+
{{#set: molecular weight=414.713    }}
+
{{#set: common name=22-dihydrochondrillasterol|24β-ethylcholest-7-en-3β-ol|chondrillast-7-enol|dihydrochondrillasterol}}
+
{{#set: consumed by=RXN-13892}}
+

Latest revision as of 17:44, 23 May 2018

Gene CHC_T00007788001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links