Difference between revisions of "CHC T00009507001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == * smiles: ** C1(=C(C([O-])=O)NC(NC(=O)1)=O) * inchi key: ** InChIKey=PXQPEW...") |
(Created page with "Category:Gene == Gene CHC_T00009507001 == * left end position: ** 100719 * transcription direction: ** NEGATIVE * right end position: ** 101276 * centisome position: ** 14...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009507001 == |
− | * | + | * left end position: |
− | ** | + | ** 100719 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 101276 |
− | * | + | * centisome position: |
− | ** | + | ** 14.700113 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PHOSPHAGLYPSYN-RXN]] | |
− | == | + | ** Source: [[annotation-original_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY4FS-7]] | ||
+ | * [[PWY4FS-8]] | ||
+ | * [[PWY-5269]] | ||
+ | * [[PWY-7817]] | ||
+ | * [[PWY-5668]] | ||
+ | * [[PWY0-1545]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=100719}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=101276}} | |
− | + | {{#set: centisome position=14.700113 }} | |
− | + | {{#set: reaction associated=PHOSPHAGLYPSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY4FS-7|PWY4FS-8|PWY-5269|PWY-7817|PWY-5668|PWY0-1545}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:44, 23 May 2018
Gene CHC_T00009507001
- left end position:
- 100719
- transcription direction:
- NEGATIVE
- right end position:
- 101276
- centisome position:
- 14.700113
- Synonym(s):
Reactions associated
- Reaction: PHOSPHAGLYPSYN-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome