Difference between revisions of "RXN-10654"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(O)C(C)=C(C)C(O)=1))C)C * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10654 RXN-10654] == * direction: ** LEFT-TO-RIGHT * common name: ** Beta-ketoacyl synthase * ec...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10654 RXN-10654] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Beta-ketoacyl synthase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[Cis-Delta5-dodecenoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[MALONYL-ACP]][c] '''=>''' 1 [[3-oxo-cis-D7-tetradecenoyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[ACP]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a (5Z)-dodec-5-enoyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 a malonyl-[acp][c] '''=>''' 1 a 3-oxo-cis-Δ7-tetradecenoyl-[acp][c] '''+''' 1 CO2[c] '''+''' 1 a holo-[acyl-carrier protein][c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00009465001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00009465001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-6282]], palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6282 PWY-6282] | ||
+ | ** '''6''' reactions found over '''9''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Beta-ketoacyl synthase}} | |
− | + | {{#set: ec number=EC-2.3.1.41}} | |
− | + | {{#set: gene associated=CHC_T00009465001_1|CHC_T00009465001}} | |
− | + | {{#set: in pathway=PWY-6282}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-original_genome|orthology-ectocarpus_siliculosus}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 17:48, 23 May 2018
Contents
Reaction RXN-10654
- direction:
- LEFT-TO-RIGHT
- common name:
- Beta-ketoacyl synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Cis-Delta5-dodecenoyl-ACPs[c] + 1 PROTON[c] + 1 MALONYL-ACP[c] => 1 3-oxo-cis-D7-tetradecenoyl-ACPs[c] + 1 CARBON-DIOXIDE[c] + 1 ACP[c]
- With common name(s):
- 1 a (5Z)-dodec-5-enoyl-[acp][c] + 1 H+[c] + 1 a malonyl-[acp][c] => 1 a 3-oxo-cis-Δ7-tetradecenoyl-[acp][c] + 1 CO2[c] + 1 a holo-[acyl-carrier protein][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00009465001_1
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00009465001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
Pathways
- PWY-6282, palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate): PWY-6282
- 6 reactions found over 9 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome