Difference between revisions of "CPD-650"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008951001 == * left end position: ** 745790 * transcription direction: ** NEGATIVE * right end position: ** 747184 * centisome position: ** 81...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-650 CPD-650] == * smiles: ** CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00008951001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-650 CPD-650] ==
* left end position:
+
* smiles:
** 745790
+
** CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=QHHKKMYHDBRONY-WZZMXTMRSA-J
* right end position:
+
* common name:
** 747184
+
** (3R)-3-hydroxybutanoyl-CoA
* centisome position:
+
* molecular weight:
** 81.680374    
+
** 849.593    
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-OH-butyryl-CoA
 +
** OH-butyryl-CoA
 +
** β-hydroxybutyryl-S-CoA
 +
** D-3-hydroxybutyryl-CoA
 +
** hydroxy-butyryl-CoA
 +
** β-hydroxybutyryl-CoA
 +
** 3-hydroxybutyryl-CoA
 +
** (3R)-3-Hydroxybutanoyl-CoA
 +
** 3-hydroxybutanoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[FUMHYDR-RXN]]
+
== Reaction(s) known to produce the compound ==
** original_genome
+
== Reaction(s) of unknown directionality ==
***automated-name-match
+
* [[5.1.2.3-RXN]]
== Pathways associated ==
+
* [[PWY-561]]
+
* [[PWY-5913]]
+
* [[P42-PWY]]
+
* [[PWY-7384]]
+
* [[PWY-5392]]
+
* [[P23-PWY]]
+
* [[P105-PWY]]
+
* [[PWY-6969]]
+
* [[FERMENTATION-PWY]]
+
* [[PWY-6728]]
+
* [[REDCITCYC]]
+
* [[PWY-7254]]
+
* [[P108-PWY]]
+
* [[TCA]]
+
* [[PWY66-398]]
+
* [[PWY-5690]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=745790}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266552 45266552]
{{#set: right end position=747184}}
+
* UM-BBD-CPD : c0030
{{#set: centisome position=81.680374    }}
+
* CHEBI:
{{#set: reaction associated=FUMHYDR-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57315 57315]
{{#set: pathway associated=PWY-561|PWY-5913|P42-PWY|PWY-7384|PWY-5392|P23-PWY|P105-PWY|PWY-6969|FERMENTATION-PWY|PWY-6728|REDCITCYC|PWY-7254|P108-PWY|TCA|PWY66-398|PWY-5690}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03561 C03561]
 +
* HMDB : HMDB01166
 +
{{#set: smiles=CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
 +
{{#set: inchi key=InChIKey=QHHKKMYHDBRONY-WZZMXTMRSA-J}}
 +
{{#set: common name=(3R)-3-hydroxybutanoyl-CoA}}
 +
{{#set: molecular weight=849.593    }}
 +
{{#set: common name=3-OH-butyryl-CoA|OH-butyryl-CoA|β-hydroxybutyryl-S-CoA|D-3-hydroxybutyryl-CoA|hydroxy-butyryl-CoA|β-hydroxybutyryl-CoA|3-hydroxybutyryl-CoA|(3R)-3-Hydroxybutanoyl-CoA|3-hydroxybutanoyl-CoA}}
 +
{{#set: reversible reaction associated=5.1.2.3-RXN}}

Revision as of 16:48, 23 May 2018

Metabolite CPD-650

  • smiles:
    • CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
  • inchi key:
    • InChIKey=QHHKKMYHDBRONY-WZZMXTMRSA-J
  • common name:
    • (3R)-3-hydroxybutanoyl-CoA
  • molecular weight:
    • 849.593
  • Synonym(s):
    • 3-OH-butyryl-CoA
    • OH-butyryl-CoA
    • β-hydroxybutyryl-S-CoA
    • D-3-hydroxybutyryl-CoA
    • hydroxy-butyryl-CoA
    • β-hydroxybutyryl-CoA
    • 3-hydroxybutyryl-CoA
    • (3R)-3-Hydroxybutanoyl-CoA
    • 3-hydroxybutanoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O" cannot be used as a page name in this wiki.