Difference between revisions of "CPD-9897"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-L-KYNURENINE 3-HYDROXY-L-KYNURENINE] == * smiles: ** C([O-])(=O)C([N+])CC(=O)C1(=C(N)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9897 CPD-9897] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9897 CPD-9897] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C)C)C)C)C |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=WCQCNOIKXGNDLX-RDSVHMIISA-M |
* common name: | * common name: | ||
− | ** 3-hydroxy- | + | ** 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 848.323 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-methoxy-4-hydroxy-5-decaprenylbenzoate |
− | ** 3-hydroxy- | + | ** 3-(3,7,11,15,19,23-decamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid |
+ | ** 3-decaprenyl-4-hydroxy-5-methoxybenzoate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-9282]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54738023 54738023] |
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62796 62796] |
− | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C)C)C)C)C}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=WCQCNOIKXGNDLX-RDSVHMIISA-M}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate}} |
− | {{#set: common name=3-hydroxy- | + | {{#set: molecular weight=848.323 }} |
− | {{#set: molecular weight= | + | {{#set: common name=3-methoxy-4-hydroxy-5-decaprenylbenzoate|3-(3,7,11,15,19,23-decamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid|3-decaprenyl-4-hydroxy-5-methoxybenzoate}} |
− | {{#set: common name= | + | {{#set: produced by=RXN-9282}} |
− | + | ||
− | {{#set: produced by= | + |
Revision as of 16:51, 23 May 2018
Contents
Metabolite CPD-9897
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C)C)C)C)C
- inchi key:
- InChIKey=WCQCNOIKXGNDLX-RDSVHMIISA-M
- common name:
- 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate
- molecular weight:
- 848.323
- Synonym(s):
- 3-methoxy-4-hydroxy-5-decaprenylbenzoate
- 3-(3,7,11,15,19,23-decamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid
- 3-decaprenyl-4-hydroxy-5-methoxybenzoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.