Difference between revisions of "CPD-14901"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-181 RXN66-181] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-181 RXN66-181] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
+
** InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N
 +
* common name:
 +
** poriferst-7-enol
 +
* molecular weight:
 +
** 414.713   
 
* Synonym(s):
 
* Synonym(s):
 +
** 22-dihydrochondrillasterol
 +
** 24β-ethylcholest-7-en-3β-ol
 +
** chondrillast-7-enol
 +
** dihydrochondrillasterol
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-13892]]
** 1 [[CPD-3481]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-3483]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 bupropion[c] '''+''' 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 oxygen[c] '''=>''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 H2O[c] '''+''' 1 hydroxybupropion[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00008799001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00008302001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00009144001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
* [[PWY66-241]], bupropion degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-241 PWY66-241]
+
** '''1''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 18525-35-4
{{#set: ec number=EC-1.14.14.1}}
+
* PUBCHEM:
{{#set: gene associated=CHC_T00008799001_1|CHC_T00008302001_1|CHC_T00009144001_1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283639 5283639]
{{#set: in pathway=PWY66-241}}
+
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=poriferst-7-enol}}
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: molecular weight=414.713    }}
 +
{{#set: common name=22-dihydrochondrillasterol|24β-ethylcholest-7-en-3β-ol|chondrillast-7-enol|dihydrochondrillasterol}}
 +
{{#set: consumed by=RXN-13892}}

Revision as of 16:53, 23 May 2018

Metabolite CPD-14901

  • smiles:
    • CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N
  • common name:
    • poriferst-7-enol
  • molecular weight:
    • 414.713
  • Synonym(s):
    • 22-dihydrochondrillasterol
    • 24β-ethylcholest-7-en-3β-ol
    • chondrillast-7-enol
    • dihydrochondrillasterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 18525-35-4
  • PUBCHEM:
"CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.