Difference between revisions of "MALEATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9556 RXN-9556] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-cis-vaccenoyl-[acyl-car...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] == * smiles: ** C([O-])(=O)C=CC([O-])=O * inchi key: ** InChIKey=VZCYOOQTPOCHF...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C([O-])(=O)C=CC([O-])=O |
| + | * inchi key: | ||
| + | ** InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** maleate |
| − | * | + | * molecular weight: |
| − | + | ** 114.057 | |
| − | + | ||
| − | + | ||
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| + | ** maleic acid | ||
| + | ** cis-butenedioic acid | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-646]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * CAS : 110-16-7 | |
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288227 5288227] | |
| − | + | * HMDB : HMDB00176 | |
| − | + | * LIGAND-CPD: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01384 C01384] | |
| − | + | * CHEMSPIDER: | |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4450430.html 4450430] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30780 30780] |
| − | {{#set: | + | {{#set: smiles=C([O-])(=O)C=CC([O-])=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L}} |
| − | {{#set: | + | {{#set: common name=maleate}} |
| − | + | {{#set: molecular weight=114.057 }} | |
| + | {{#set: common name=maleic acid|cis-butenedioic acid}} | ||
| + | {{#set: produced by=RXN-646}} | ||
Revision as of 16:53, 23 May 2018
Contents
Metabolite MALEATE
- smiles:
- C([O-])(=O)C=CC([O-])=O
- inchi key:
- InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L
- common name:
- maleate
- molecular weight:
- 114.057
- Synonym(s):
- maleic acid
- cis-butenedioic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 110-16-7
- PUBCHEM:
- HMDB : HMDB00176
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
"C([O-])(=O)C=CC([O-])=O" cannot be used as a page name in this wiki.
