Difference between revisions of "RXN-12561"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8843 CPD-8843] == * smiles: ** C=CC(CCC=C(CCC=C(C)C)C)(O)C * common name: ** (3R,6E)-neroli...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12561 RXN-12561] == * direction: ** REVERSIBLE * common name: ** acetyl-CoA acetyltransferase *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12561 RXN-12561] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
* common name: | * common name: | ||
| − | ** | + | ** acetyl-CoA acetyltransferase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.9 EC-2.3.1.9] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[PROPIONYL-COA]][c] '''+''' 1 [[ACETYL-COA]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-13534]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 propanoyl-CoA[c] '''+''' 1 acetyl-CoA[c] '''<=>''' 1 coenzyme A[c] '''+''' 1 β-ketovaleryl-CoA[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[CHC_T00008981001_1]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | * Gene: [[CHC_T00008981001]] | ||
| + | ** Source: [[annotation-original_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-original_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=acetyl-CoA acetyltransferase}} | |
| − | + | {{#set: ec number=EC-2.3.1.9}} | |
| − | + | {{#set: gene associated=CHC_T00008981001_1|CHC_T00008981001}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology|annotation}} | |
| − | + | {{#set: reconstruction source=annotation-original_genome|orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}} | |
| − | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:53, 23 May 2018
Contents
Reaction RXN-12561
- direction:
- REVERSIBLE
- common name:
- acetyl-CoA acetyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROPIONYL-COA[c] + 1 ACETYL-COA[c] <=> 1 CO-A[c] + 1 CPD-13534[c]
- With common name(s):
- 1 propanoyl-CoA[c] + 1 acetyl-CoA[c] <=> 1 coenzyme A[c] + 1 β-ketovaleryl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00008981001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00008981001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome
