Difference between revisions of "COBINAMIDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COBINAMIDE COBINAMIDE] == * smiles: ** CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COBINAMIDE COBINAMIDE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8)))) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M |
* common name: | * common name: | ||
| − | ** | + | ** cobinamide |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 990.096 |
* Synonym(s): | * Synonym(s): | ||
| + | ** Cbi | ||
| + | ** cobyrinic acid a,c-diamide | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[BTUR2-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CAS : 1867-62-5 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820010 91820010] |
| − | * | + | * HMDB : HMDB06902 |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05774 C05774] |
| − | {{#set: smiles= | + | * CHEBI: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28956 28956] |
| − | {{#set: common name= | + | * BIGG : cbi |
| − | {{#set: molecular weight= | + | {{#set: smiles=CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))}} |
| − | {{#set: consumed by= | + | {{#set: inchi key=InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M}} |
| + | {{#set: common name=cobinamide}} | ||
| + | {{#set: molecular weight=990.096 }} | ||
| + | {{#set: common name=Cbi|cobyrinic acid a,c-diamide}} | ||
| + | {{#set: consumed by=BTUR2-RXN}} | ||
Revision as of 16:54, 23 May 2018
Contents
Metabolite COBINAMIDE
- smiles:
- CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))
- inchi key:
- InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M
- common name:
- cobinamide
- molecular weight:
- 990.096
- Synonym(s):
- Cbi
- cobyrinic acid a,c-diamide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))" cannot be used as a page name in this wiki.
